loading...| Preferred Name |
perfluorodecalin |
|
| Synonyms |
decahydrooctadecafluoronaphthalene 1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8,8a-octadecafluorodecahydronaphthalene octadecafluorodecaline Perflunafene FDC octadecafluorodecahydronaphthalene perfluorodecalin |
|
| Definitions |
A fluorocarbon that is decalin in which every hydrogen is replaced by fluorine. Capable of dissolving large quantities of oxygen, it has been used as the basis of an artificial blood substitute. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_38848 |
|
| alternative term |
decahydrooctadecafluoronaphthalene 1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8,8a-octadecafluorodecahydronaphthalene octadecafluorodecaline Perflunafene FDC octadecafluorodecahydronaphthalene perfluorodecalin |
|
| bearer of | ||
| charge |
0 |
|
| database_cross_reference |
Beilstein:2067113 PMID:22006656 CAS:306-94-5 Wikipedia:Perfluorodecalin PMID:19682704 Drug_Central:2103 Gmelin:1438536 |
|
| definition |
A fluorocarbon that is decalin in which every hydrogen is replaced by fluorine. Capable of dissolving large quantities of oxygen, it has been used as the basis of an artificial blood substitute. |
|
| formula |
C10F18 |
|
| has_exact_synonym |
octadecafluorodecahydronaphthalene perfluorodecalin |
|
| has_obo_namespace |
chebi_ontology |
|
| has_parent_hydride | ||
| has_related_synonym |
decahydrooctadecafluoronaphthalene 1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8,8a-octadecafluorodecahydronaphthalene octadecafluorodecaline Perflunafene FDC |
|
| id |
CHEBI:38848 |
|
| in_subset | ||
| inchi |
InChI=1S/C10F18/c11-1-2(12,5(17,18)9(25,26)7(21,22)3(1,13)14)6(19,20)10(27,28)8(23,24)4(1,15)16 |
|
| inchikey |
UWEYRJFJVCLAGH-UHFFFAOYSA-N |
|
| label |
perfluorodecalin |
|
| mass |
462.07826 |
|
| monoisotopicmass |
461.97126 |
|
| notation |
CHEBI:38848 |
|
| prefLabel |
perfluorodecalin |
|
| RO_0000087 | ||
| smiles |
FC1(F)C(F)(F)C(F)(F)C2(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C2(F)C1(F)F |
|
| subClassOf |