loading...| Preferred Name |
clomipramine hydrochloride |
|
| Synonyms |
3-(3-chloro-10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethylpropan-1-amine hydrochloride 3-(3-chloro-10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethylpropan-1-aminium chloride 3-chloroimipramine hydrochloride clomipramine HCl clomipramine monohydrochloride chloroimipramine monohydrochloride Anafranil |
|
| Definitions |
A hydrochloride resulting from the reaction of equimolar amounts of clomipramine and hydrogen chloride. One of the more sedating tricyclic antidepressants, it is used for the treatment of depression as well as obsessive-compulsive disorder and phobias. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3755 |
|
| charge |
0 |
|
| database_cross_reference |
DrugBank:DB01242 Reaxys:4168494 CAS:17321-77-6 KEGG:D00811 VSDB:1812 |
|
| definition |
A hydrochloride resulting from the reaction of equimolar amounts of clomipramine and hydrogen chloride. One of the more sedating tricyclic antidepressants, it is used for the treatment of depression as well as obsessive-compulsive disorder and phobias. |
|
| formula |
C19H24Cl2N2 |
|
| has part | ||
| has_exact_synonym |
3-(3-chloro-10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethylpropan-1-amine hydrochloride |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
3-(3-chloro-10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethylpropan-1-aminium chloride 3-chloroimipramine hydrochloride clomipramine HCl clomipramine monohydrochloride chloroimipramine monohydrochloride Anafranil |
|
| id |
CHEBI:3755 |
|
| in_subset | ||
| inchi |
InChI=1S/C19H23ClN2.ClH/c1-21(2)12-5-13-22-18-7-4-3-6-15(18)8-9-16-10-11-17(20)14-19(16)22;/h3-4,6-7,10-11,14H,5,8-9,12-13H2,1-2H3;1H |
|
| inchikey |
WIMWMKZEIBHDTH-UHFFFAOYSA-N |
|
| label |
clomipramine hydrochloride |
|
| mass |
351.31300 |
|
| monoisotopicmass |
350.13165 |
|
| notation |
CHEBI:3755 |
|
| prefLabel |
clomipramine hydrochloride |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_149553 |
|
| smiles |
Cl.CN(C)CCCN1c2ccccc2CCc2ccc(Cl)cc12 |
|
| subClassOf |