loading...| Preferred Name |
clemastine fumarate |
|
| Synonyms |
(2R)-2-{2-[(1R)-1-(4-chlorophenyl)-1-phenylethoxy]ethyl}-1-methylpyrrolidine (2E)-but-2-enedioate (+)-(2R)-2-(2-(((R)-p-chloro-alpha-methyl-alpha-phenylbenzyl)oxy)ethyl)-1-methylpyrrolidine fumarate (1:1) clemastine hydrogen fumarate (2R)-2-{2-[(1R)-1-(4-chlorophenyl)-1-phenylethoxy]ethyl}-1-methylpyrrolidinium (2E)-3-carboxyprop-2-enoate |
|
| Definitions |
The fumaric acid salt of clemastine. An antihistamine with antimuscarinic and moderate sedative properties, it is used for the symptomatic relief of allergic conditions such as rhinitis, urticaria, conjunctivitis and in pruritic (severe itching) skin conditions. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3739 |
|
| charge |
0 |
|
| database_cross_reference |
DrugBank:DB00283 CAS:14976-57-9 Beilstein:6472482 KEGG:D00666 |
|
| definition |
The fumaric acid salt of clemastine. An antihistamine with antimuscarinic and moderate sedative properties, it is used for the symptomatic relief of allergic conditions such as rhinitis, urticaria, conjunctivitis and in pruritic (severe itching) skin conditions. |
|
| formula |
C25H30ClNO5 |
|
| has part | ||
| has_exact_synonym |
(2R)-2-{2-[(1R)-1-(4-chlorophenyl)-1-phenylethoxy]ethyl}-1-methylpyrrolidine (2E)-but-2-enedioate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(+)-(2R)-2-(2-(((R)-p-chloro-alpha-methyl-alpha-phenylbenzyl)oxy)ethyl)-1-methylpyrrolidine fumarate (1:1) clemastine hydrogen fumarate (2R)-2-{2-[(1R)-1-(4-chlorophenyl)-1-phenylethoxy]ethyl}-1-methylpyrrolidinium (2E)-3-carboxyprop-2-enoate |
|
| id |
CHEBI:3739 |
|
| in_subset | ||
| inchi |
InChI=1S/C21H26ClNO.C4H4O4/c1-21(17-7-4-3-5-8-17,18-10-12-19(22)13-11-18)24-16-14-20-9-6-15-23(20)2;5-3(6)1-2-4(7)8/h3-5,7-8,10-13,20H,6,9,14-16H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t20-,21-;/m1./s1 |
|
| inchikey |
PMGQWSIVQFOFOQ-YKVZVUFRSA-N |
|
| label |
clemastine fumarate |
|
| mass |
459.96200 |
|
| monoisotopicmass |
459.18125 |
|
| notation |
CHEBI:3739 |
|
| prefLabel |
clemastine fumarate |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_37955 http://purl.obolibrary.org/obo/CHEBI_48876 |
|
| smiles |
OC(=O)\C=C\C(O)=O.[H][C@@]1(CCCN1C)CCO[C@](C)(c1ccccc1)c1ccc(Cl)cc1 |
|
| subClassOf |