Preferred Name |
4-coumaric acid |
|
Synonyms |
4-coumaric acid 3-(4-hydroxyphenyl)prop-2-enoic acid p-hydroxycinnamic acid beta-[4-hydroxyphenyl]acrylic acid 3-(4-hydroxyphenyl)acrylic acid para-coumaric acid p-coumaric acid 4'-hydroxycinnamic acid p-hydroxyphenylacrylic acid 4-hydroxycinnamic acid 3-(4-hydroxyphenyl)-2-propenoic acid |
|
Definitions |
A coumaric acid in which the hydroxy substituent is located at C-4 of the phenyl ring. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_36090 |
|
charge |
0 |
|
database_cross_reference |
PMID:22447332 PMID:23485470 PMID:23810795 PMID:23857900 CAS:7400-08-0 Wikipedia:4-coumaric_acid PMID:23178520 PMID:23684599 PMID:24927550 PMID:7285584 PMID:23669407 PMID:19930809 PMID:23892112 Beilstein:2207381 PMID:22923003 PMID:11684179 PMID:19089825 PMID:22585412 PMID:23420453 |
|
definition |
A coumaric acid in which the hydroxy substituent is located at C-4 of the phenyl ring. |
|
formula |
C9H8O3 |
|
has_alternative_id |
CHEBI:20348 CHEBI:20405 |
|
has_exact_synonym |
4-coumaric acid 3-(4-hydroxyphenyl)prop-2-enoic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
p-hydroxycinnamic acid beta-[4-hydroxyphenyl]acrylic acid 3-(4-hydroxyphenyl)acrylic acid para-coumaric acid p-coumaric acid 4'-hydroxycinnamic acid p-hydroxyphenylacrylic acid 4-hydroxycinnamic acid 3-(4-hydroxyphenyl)-2-propenoic acid |
|
id |
CHEBI:36090 |
|
in_subset | ||
inchi |
InChI=1S/C9H8O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6,10H,(H,11,12) |
|
inchikey |
NGSWKAQJJWESNS-UHFFFAOYSA-N |
|
is_conjugate_acid_of | ||
label |
4-coumaric acid |
|
mass |
164.15802 |
|
monoisotopicmass |
164.04734 |
|
notation |
CHEBI:36090 |
|
prefLabel |
4-coumaric acid |
|
RO_0000087 | ||
smiles |
[H]C(=Cc1ccc(O)cc1)C(O)=O |
|
subClassOf |