loading...| Preferred Name |
oxybenzone |
|
| Synonyms |
(2-hydroxy-4-methoxyphenyl)(phenyl)methanone 2-Hydroxy-4-methoxybenzophenone 2-Benzoyl-5-methoxyphenol oxybenzonum 4-Methoxy-2-hydroxybenzophenone Benzophenone-3 oxibenzona oxybenzone |
|
| Definitions |
A hydroxybenzophenone that is benzophenone which is substituted at the 2- and 4-positions of one of the benzene rings by hydroxy and methoxy groups respectively. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_34283 |
|
| charge |
0 |
|
| database_cross_reference |
LINCS:LSM-3309 Reaxys:1913145 PMID:26736174 PMID:26118430 Patent:US3073866 Patent:US2773903 Beilstein:1913145 HMDB:HMDB0015497 CAS:131-57-7 PMID:26686077 PMID:26295590 PMID:26487337 PMID:28192168 PMID:27796700 KEGG:D05309 KEGG:C14285 PMID:27544106 PMID:22721600 PMID:26167727 PMID:27085067 Patent:US2861105 Wikipedia:Oxybenzone DrugBank:DB01428 Drug_Central:3412 PMID:11169173 Patent:US2861104 PMID:26589946 |
|
| definition |
A hydroxybenzophenone that is benzophenone which is substituted at the 2- and 4-positions of one of the benzene rings by hydroxy and methoxy groups respectively. |
|
| formula |
C14H12O3 |
|
| has_alternative_id |
CHEBI:569732 |
|
| has_exact_synonym |
(2-hydroxy-4-methoxyphenyl)(phenyl)methanone |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-Hydroxy-4-methoxybenzophenone 2-Benzoyl-5-methoxyphenol oxybenzonum 4-Methoxy-2-hydroxybenzophenone Benzophenone-3 oxibenzona oxybenzone |
|
| id |
CHEBI:34283 |
|
| in_subset | ||
| inchi |
InChI=1S/C14H12O3/c1-17-11-7-8-12(13(15)9-11)14(16)10-5-3-2-4-6-10/h2-9,15H,1H3 |
|
| inchikey |
DXGLGDHPHMLXJC-UHFFFAOYSA-N |
|
| label |
oxybenzone |
|
| mass |
228.24330 |
|
| monoisotopicmass |
228.07864 |
|
| notation |
CHEBI:34283 |
|
| prefLabel |
oxybenzone |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_35703 http://purl.obolibrary.org/obo/CHEBI_73335 http://purl.obolibrary.org/obo/CHEBI_50267 |
|
| smiles |
COc1ccc(C(=O)c2ccccc2)c(O)c1 |
|
| subClassOf |