Preferred Name |
diamond |
|
Synonyms |
carbon(cF8) diamond Cn Diamant adamas diamant diamante |
|
Definitions |
An allotropic form of the element carbon with cubic structure which is thermodynamically stable at pressures above 6 GPa at room temperature and metastable at atmospheric pressure. At low pressures diamond converts rapidly to graphite at temperatures above 1900 K in an inert atmosphere. The chemical bonding between the carbon atoms is covalent with sp(3) hybridization. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_33417 |
|
charge |
0 |
|
database_cross_reference |
CAS:7782-40-3 Gmelin:15667 Gmelin:13847 |
|
definition |
An allotropic form of the element carbon with cubic structure which is thermodynamically stable at pressures above 6 GPa at room temperature and metastable at atmospheric pressure. At low pressures diamond converts rapidly to graphite at temperatures above 1900 K in an inert atmosphere. The chemical bonding between the carbon atoms is covalent with sp(3) hybridization. |
|
formula |
C |
|
has_exact_synonym |
carbon(cF8) diamond |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Cn Diamant adamas diamant diamante |
|
id |
CHEBI:33417 |
|
in_subset | ||
label |
diamond |
|
mass |
497.746 |
|
monoisotopicmass |
497.32083 |
|
notation |
CHEBI:33417 |
|
prefLabel |
diamond |
|
smiles |
*[C@]12C[C@H]3C[C@@]45C[C@]67C[C@H]8C[C@@H]9[C@H]%10[C@@H]%11[C@H]%12[C@@H]%13C[C@@H]%14C[C@]%12%12C[C@@]%10(C8)[C@H]6[C@@]68[C@@H]%12[C@]%10(C%14)C[C@@](C3)([C@H]1[C@@H]([C@H]%13%10)[C@@]%116[C@@H]([C@H]79)[C@H]24)[C@@H]58 |
|
subClassOf |