Preferred Name |
calcium acetate |
|
Synonyms |
calcium diacetate acetate of lime calcium ethanoate brown acetate of lime lime pyrolignite calcium(II) acetate gray acetate of lime lime acetate Ca(OAc)2 |
|
Definitions |
The calcium salt of acetic acid. It is used, commonly as a hydrate, to treat hyperphosphataemia (excess phosphate in the blood) in patients with kidney disease: the calcium ion combines with dietary phosphate to form (insoluble) calcium phosphate, which is excreted in the faeces. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3310 |
|
charge |
0 |
|
database_cross_reference |
DrugBank:DB00258 CAS:62-54-4 KEGG:D00931 Beilstein:3692527 Gmelin:22320 |
|
definition |
The calcium salt of acetic acid. It is used, commonly as a hydrate, to treat hyperphosphataemia (excess phosphate in the blood) in patients with kidney disease: the calcium ion combines with dietary phosphate to form (insoluble) calcium phosphate, which is excreted in the faeces. |
|
formula |
C4H6CaO4 |
|
has part | ||
has_exact_synonym |
calcium diacetate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
acetate of lime calcium ethanoate brown acetate of lime lime pyrolignite calcium(II) acetate gray acetate of lime lime acetate Ca(OAc)2 |
|
id |
CHEBI:3310 |
|
in_subset | ||
inchi |
InChI=1S/2C2H4O2.Ca/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2 |
|
inchikey |
VSGNNIFQASZAOI-UHFFFAOYSA-L |
|
label |
calcium acetate |
|
mass |
158.16600 |
|
monoisotopicmass |
157.98920 |
|
notation |
CHEBI:3310 |
|
prefLabel |
calcium acetate |
|
RO_0000087 | ||
smiles |
[Ca++].CC([O-])=O.CC([O-])=O |
|
subClassOf |