loading...| Preferred Name |
midodrine hydrochloride |
|
| Synonyms |
rac-N-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]glycinamide hydrochloride (+-)-1-(2',5'-Dimethoxyphenyl)-2-glycinamidoethanol hydrochloride Midodrine HCl (+-)-2-Amino-N-(beta-hydroxy-2,5-dimethoxyphenethyl)acetamide monohydrochloride (+-)-Midodrine hydrochloride Pro-Amatine ProAmatine |
|
| Definitions |
A hydrochloride resulting from the combination of equimolar amounts of midodrine and hydrogen chloride. Midodrine is a direct-acting sympathomimetic with selective alpha-adrenergic agonist activity. The hydrochloride salt is used as a peripheral vasoconstrictor in the treatment of certain hypotensive states. The main active moiety is its major metabolite, deglymidodrine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_31847 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:D01307 Patent:WO2004018409 HMDB:HMDB0014356 DrugBank:DB00211 Reaxys:6579688 PMID:21301135 PMID:20801263 CAS:3092-17-9 |
|
| definition |
A hydrochloride resulting from the combination of equimolar amounts of midodrine and hydrogen chloride. Midodrine is a direct-acting sympathomimetic with selective alpha-adrenergic agonist activity. The hydrochloride salt is used as a peripheral vasoconstrictor in the treatment of certain hypotensive states. The main active moiety is its major metabolite, deglymidodrine. |
|
| formula |
C12H19ClN2O4 C12H18N2O4.HCl |
|
| has part | ||
| has_exact_synonym |
rac-N-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]glycinamide hydrochloride |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(+-)-1-(2',5'-Dimethoxyphenyl)-2-glycinamidoethanol hydrochloride Midodrine HCl (+-)-2-Amino-N-(beta-hydroxy-2,5-dimethoxyphenethyl)acetamide monohydrochloride (+-)-Midodrine hydrochloride Pro-Amatine ProAmatine |
|
| id |
CHEBI:31847 |
|
| in_subset | ||
| inchi |
InChI=1S/C12H18N2O4.ClH/c1-17-8-3-4-11(18-2)9(5-8)10(15)7-14-12(16)6-13;/h3-5,10,15H,6-7,13H2,1-2H3,(H,14,16);1H |
|
| inchikey |
MGCQZNBCJBRZDT-UHFFFAOYSA-N |
|
| label |
midodrine hydrochloride |
|
| mass |
290.74300 |
|
| monoisotopicmass |
290.10333 |
|
| notation |
CHEBI:31847 |
|
| prefLabel |
midodrine hydrochloride |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_35524 |
|
| smiles |
Cl.COc1ccc(OC)c(c1)C(O)CNC(=O)CN |
|
| subClassOf |