Preferred Name |
aceclofenac |
|
Synonyms |
(2-{2-[(2,6-dichlorophenyl)amino]phenyl}acetoxy)acetic acid aceclofenaco 2-[(2',6'-dichlorophenyl)amino]phenylacetoxyacetic acid 2-[(2,6-dichlorophenyl)amino]phenylacetoxyacetic acid aceclofenac 2-[(2,6-dichlorophenyl)amino]benzeneacetic acid carboxymethyl ester glycolic acid [o-(2,6-dichloroanilino)phenyl]acetate ester aceclofenacum Cincofen Clanza Hifenac PR-82/3 |
|
Definitions |
A monocarboxylic acid that is the carboxymethyl ester of diclofenac. A non-steroidal anti-inflammatory drug related to diclofenac, it is used in the management of osteoarthritis, rheumatoid arthritis, and ankylosing spondylitis. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_31159 |
|
charge |
0 |
|
database_cross_reference |
Drug_Central:43 PMID:23944964 Wikipedia:Aceclofenac CAS:89796-99-6 KEGG:D01545 PMID:23261744 PMID:11511027 Patent:US4548952 LINCS:LSM-5762 PMID:22807412 Reaxys:4884476 Patent:ES8404783 |
|
definition |
A monocarboxylic acid that is the carboxymethyl ester of diclofenac. A non-steroidal anti-inflammatory drug related to diclofenac, it is used in the management of osteoarthritis, rheumatoid arthritis, and ankylosing spondylitis. |
|
formula |
C16H13Cl2NO4 |
|
has_exact_synonym |
(2-{2-[(2,6-dichlorophenyl)amino]phenyl}acetoxy)acetic acid |
|
has_functional_parent | ||
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
aceclofenaco 2-[(2',6'-dichlorophenyl)amino]phenylacetoxyacetic acid 2-[(2,6-dichlorophenyl)amino]phenylacetoxyacetic acid aceclofenac 2-[(2,6-dichlorophenyl)amino]benzeneacetic acid carboxymethyl ester glycolic acid [o-(2,6-dichloroanilino)phenyl]acetate ester aceclofenacum Cincofen Clanza Hifenac PR-82/3 |
|
id |
CHEBI:31159 |
|
in_subset | ||
inchi |
InChI=1S/C16H13Cl2NO4/c17-11-5-3-6-12(18)16(11)19-13-7-2-1-4-10(13)8-15(22)23-9-14(20)21/h1-7,19H,8-9H2,(H,20,21) |
|
inchikey |
MNIPYSSQXLZQLJ-UHFFFAOYSA-N |
|
label |
aceclofenac |
|
mass |
354.18500 |
|
monoisotopicmass |
353.02216 |
|
notation |
CHEBI:31159 |
|
prefLabel |
aceclofenac |
|
RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_35544 |
|
smiles |
OC(=O)COC(=O)Cc1ccccc1Nc1c(Cl)cccc1Cl |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_50995 http://purl.obolibrary.org/obo/CHEBI_33308 http://purl.obolibrary.org/obo/CHEBI_33709 |