loading...| Preferred Name |
synephrine |
|
| Synonyms |
1-(4-hydroxyphenyl)-2-(methylamino)ethanol Synephrine (+/-)-Synephrine p-hydroxy-alpha-[(methylamino)methyl]benzyl alcohol beta-methylamino-alpha-(4-hydroxyphenyl)ethyl alcohol 1-(4-Hydroxyphenyl)-2-(methylamino)ethanol 1-(4-hydroxyphenyl)-2-methylaminoethanol 4-hydroxy-alpha-[(methylamino)methyl]benzenemethanol Oxedrine Sympatol |
|
| Definitions |
A phenethylamine alkaloid that is 4-(2-aminoethyl)phenol substituted by a hydroxy group at position 1 and a methyl group at the amino nitrogen. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_29081 |
|
| charge |
0 |
|
| database_cross_reference |
Beilstein:1103010 Drug_Central:3577 CAS:94-07-5 PMID:18077120 KEGG:D07148 PMID:17675045 KEGG:C04548 LINCS:LSM-4956 PMID:23682231 Wikipedia:Synephrine |
|
| definition |
A phenethylamine alkaloid that is 4-(2-aminoethyl)phenol substituted by a hydroxy group at position 1 and a methyl group at the amino nitrogen. |
|
| formula |
C9H13NO2 |
|
| has_alternative_id |
CHEBI:18964 CHEBI:11190 CHEBI:570 |
|
| has_exact_synonym |
1-(4-hydroxyphenyl)-2-(methylamino)ethanol Synephrine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(+/-)-Synephrine p-hydroxy-alpha-[(methylamino)methyl]benzyl alcohol beta-methylamino-alpha-(4-hydroxyphenyl)ethyl alcohol 1-(4-Hydroxyphenyl)-2-(methylamino)ethanol 1-(4-hydroxyphenyl)-2-methylaminoethanol 4-hydroxy-alpha-[(methylamino)methyl]benzenemethanol Oxedrine Sympatol |
|
| id |
CHEBI:29081 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H13NO2/c1-10-6-9(12)7-2-4-8(11)5-3-7/h2-5,9-12H,6H2,1H3 |
|
| inchikey |
YRCWQPVGYLYSOX-UHFFFAOYSA-N |
|
| is_conjugate_base_of | ||
| label |
synephrine |
|
| mass |
167.20500 |
|
| monoisotopicmass |
167.09463 |
|
| notation |
CHEBI:29081 |
|
| prefLabel |
synephrine |
|
| RO_0000087 | ||
| smiles |
CNCC(O)c1ccc(O)cc1 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_23981 |