loading...| Preferred Name |
3-aminophenol |
|
| Synonyms |
3-aminophenol 3-Aminophenol m-Aminophenol m-hydroxyaniline |
|
| Definitions |
An aminophenol that is one of three amino derivatives of phenol which has the single amino substituent located meta to the phenolic -OH group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28924 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:591-27-5 PMID:1395635 KEGG:C05058 Beilstein:636059 PMID:21399792 Gmelin:2913 Wikipedia:3-Aminophenol Reaxys:636059 |
|
| definition |
An aminophenol that is one of three amino derivatives of phenol which has the single amino substituent located meta to the phenolic -OH group. |
|
| formula |
C6H7NO |
|
| has_alternative_id |
CHEBI:10585 CHEBI:19965 |
|
| has_exact_synonym |
3-aminophenol 3-Aminophenol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
m-Aminophenol m-hydroxyaniline |
|
| id |
CHEBI:28924 |
|
| in_subset | ||
| inchi |
InChI=1S/C6H7NO/c7-5-2-1-3-6(8)4-5/h1-4,8H,7H2 |
|
| inchikey |
CWLKGDAVCFYWJK-UHFFFAOYSA-N |
|
| label |
3-aminophenol |
|
| mass |
109.12592 |
|
| monoisotopicmass |
109.05276 |
|
| notation |
CHEBI:28924 |
|
| prefLabel |
3-aminophenol |
|
| smiles |
Nc1cccc(O)c1 |
|
| subClassOf |