loading...| Preferred Name |
mescaline |
|
| Synonyms |
2-(3,4,5-trimethoxyphenyl)ethanamine Mescaline 3,4,5-trimethoxybenzeneethanamine 1-amino-2-(3,4,5-trimethoxyphenyl)ethane 3,4,5-trimethoxyphenethylamine 3,4,5-trimethoxyphenylethylamine Mescalin Meskalin TMPEA mescalina mezcalina |
|
| Definitions |
A phenethylamine alkaloid that is phenethylamine substituted at positions 3, 4 and 5 by methoxy groups. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28346 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:22251567 Reaxys:1374088 PMID:22900815 Beilstein:1374088 CAS:54-04-6 KEGG:C06546 Wikipedia:Mescaline PMID:20890669 PMID:14516493 PMID:25036425 KNApSAcK:C00001419 |
|
| definition |
A phenethylamine alkaloid that is phenethylamine substituted at positions 3, 4 and 5 by methoxy groups. |
|
| formula |
C11H17NO3 |
|
| has_alternative_id |
CHEBI:25202 CHEBI:6776 |
|
| has_exact_synonym |
2-(3,4,5-trimethoxyphenyl)ethanamine Mescaline |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
3,4,5-trimethoxybenzeneethanamine 1-amino-2-(3,4,5-trimethoxyphenyl)ethane 3,4,5-trimethoxyphenethylamine 3,4,5-trimethoxyphenylethylamine Mescalin Meskalin TMPEA mescalina mezcalina |
|
| id |
CHEBI:28346 |
|
| in_subset | ||
| inchi |
InChI=1S/C11H17NO3/c1-13-9-6-8(4-5-12)7-10(14-2)11(9)15-3/h6-7H,4-5,12H2,1-3H3 |
|
| inchikey |
RHCSKNNOAZULRK-UHFFFAOYSA-N |
|
| label |
mescaline |
|
| mass |
211.25760 |
|
| monoisotopicmass |
211.12084 |
|
| notation |
CHEBI:28346 |
|
| prefLabel |
mescaline |
|
| RO_0000087 | ||
| smiles |
COc1cc(CCN)cc(OC)c1OC |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_51683 |