loading...| Preferred Name |
cinnamic acid |
|
| Synonyms |
Cinnamic acid 3-phenylprop-2-enoic acid 3-phenylacrylic acid benzylideneacetic acid phenylacrylic acid beta-phenylacrylic acid 3-phenyl-2-propenoic acid benzenepropenoic acid PhCH=CHCO2H 3-phenylpropenoic acid Zimtsaeure |
|
| Definitions |
A monocarboxylic acid that consists of acrylic acid bearing a phenyl substituent at the 3-position. It is found in Cinnamomum cassia. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_27386 |
|
| charge |
0 |
|
| database_cross_reference |
Beilstein:507757 PMID:24636064 Gmelin:328659 PMID:19238838 CAS:621-82-9 PMID:24868863 Reaxys:507757 HMDB:HMDB0000567 PMID:7628877 KEGG:C10438 Wikipedia:Cinnamic_acid |
|
| definition |
A monocarboxylic acid that consists of acrylic acid bearing a phenyl substituent at the 3-position. It is found in Cinnamomum cassia. |
|
| formula |
C9H8O2 |
|
| has_alternative_id |
CHEBI:23250 CHEBI:3710 |
|
| has_exact_synonym |
Cinnamic acid 3-phenylprop-2-enoic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
3-phenylacrylic acid benzylideneacetic acid phenylacrylic acid beta-phenylacrylic acid 3-phenyl-2-propenoic acid benzenepropenoic acid PhCH=CHCO2H 3-phenylpropenoic acid Zimtsaeure |
|
| id |
CHEBI:27386 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H8O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H,10,11) |
|
| inchikey |
WBYWAXJHAXSJNI-UHFFFAOYSA-N |
|
| is_conjugate_acid_of | ||
| label |
cinnamic acid |
|
| mass |
148.15862 |
|
| monoisotopicmass |
148.05243 |
|
| notation |
CHEBI:27386 |
|
| prefLabel |
cinnamic acid |
|
| RO_0000087 | ||
| smiles |
[H]C(=Cc1ccccc1)C(O)=O |
|
| subClassOf |