Preferred Name |
acetylcholine chloride |
|
Synonyms |
Acetylcholine chloride 2-acetyloxy-N,N,N-trimethylethanaminium chloride Chloroacetylcholine (2-Hydroxyethyl)trimethylammonium chloride acetate 2-Acetoxyethyltrimethylammonium chloride Miochol |
|
Definitions |
The chloride salt of acetylcholine, and a parasympatomimetic drug. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_2417 |
|
charge |
0 |
|
database_cross_reference |
KEGG:D00999 Beilstein:3571875 CAS:60-31-1 KEGG:C08201 |
|
definition |
The chloride salt of acetylcholine, and a parasympatomimetic drug. |
|
formula |
C7H16NO2.Cl |
|
has part | ||
has_exact_synonym |
Acetylcholine chloride 2-acetyloxy-N,N,N-trimethylethanaminium chloride |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Chloroacetylcholine (2-Hydroxyethyl)trimethylammonium chloride acetate 2-Acetoxyethyltrimethylammonium chloride Miochol |
|
id |
CHEBI:2417 |
|
in_subset | ||
inchi |
InChI=1S/C7H16NO2.ClH/c1-7(9)10-6-5-8(2,3)4;/h5-6H2,1-4H3;1H/q+1;/p-1 |
|
inchikey |
JUGOREOARAHOCO-UHFFFAOYSA-M |
|
label |
acetylcholine chloride |
|
mass |
181.66000 |
|
monoisotopicmass |
181.08696 |
|
notation |
CHEBI:2417 |
|
prefLabel |
acetylcholine chloride |
|
smiles |
[Cl-].CC(=O)OCC[N+](C)(C)C |
|
subClassOf |