loading...| Preferred Name |
1-(3-chlorophenyl)piperazine |
|
| Synonyms |
1-(3-chlorophenyl)piperazine 1-(3-Chlorophenyl)piperazine m-Chlorophenylpiperazine (m-CPP) |
|
| Definitions |
A N-arylpiperazine that is piperazine carrying a 3-chlorophenyl substituent at position 1. It is a metabolite of the antidepressant drug trazodone. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_10588 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:6640-24-0 PMID:24062697 HMDB:HMDB0061008 Beilstein:8409 KEGG:C11738 Wikipedia:Meta-Chlorophenylpiperazine LINCS:LSM-25627 PMID:11311791 PMID:18621591 PMID:23768699 Reaxys:8409 PMID:6827905 |
|
| definition |
A N-arylpiperazine that is piperazine carrying a 3-chlorophenyl substituent at position 1. It is a metabolite of the antidepressant drug trazodone. |
|
| formula |
C10H13ClN2 |
|
| has_exact_synonym |
1-(3-chlorophenyl)piperazine 1-(3-Chlorophenyl)piperazine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
m-Chlorophenylpiperazine (m-CPP) |
|
| id |
CHEBI:10588 |
|
| in_subset | ||
| inchi |
InChI=1S/C10H13ClN2/c11-9-2-1-3-10(8-9)13-6-4-12-5-7-13/h1-3,8,12H,4-7H2 |
|
| inchikey |
VHFVKMTVMIZMIK-UHFFFAOYSA-N |
|
| label |
1-(3-chlorophenyl)piperazine |
|
| mass |
196.67640 |
|
| monoisotopicmass |
196.07673 |
|
| notation |
CHEBI:10588 |
|
| prefLabel |
1-(3-chlorophenyl)piperazine |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_49103 http://purl.obolibrary.org/obo/CHEBI_35703 |
|
| smiles |
Clc1cccc(c1)N1CCNCC1 |
|
| subClassOf |