Preferred Name |
yohimbine |
|
Synonyms |
methyl 17alpha-hydroxyyohimban-16alpha-carboxylate Yohimbine (+)-yohimbine yohimbic acid methyl ester quebrachine 17alpha-hydroxyyohimban-16alpha-carboxylic acid methyl ester (16alpha,17alpha)-17-hydroxyyohimban-16-carboxylic acid methyl ester Johimbin Quebrachin Yohimbin aphrodine corynine |
|
Definitions |
An indole alkaloid with alpha2-adrenoceptor antagonist activity. It is produced by Corynanthe johimbe and Rauwolfia serpentina. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_10093 |
|
charge |
0 |
|
database_cross_reference |
CAS:146-48-5 Beilstein:97276 KEGG:C09256 Beilstein:4720812 Drug_Central:3659 KEGG:D08685 KNApSAcK:C00001789 DrugBank:DB01392 LINCS:LSM-2779 VSDB:3010 |
|
definition |
An indole alkaloid with alpha2-adrenoceptor antagonist activity. It is produced by Corynanthe johimbe and Rauwolfia serpentina. |
|
formula |
C21H26N2O3 |
|
has_exact_synonym |
methyl 17alpha-hydroxyyohimban-16alpha-carboxylate Yohimbine |
|
has_functional_parent | ||
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(+)-yohimbine yohimbic acid methyl ester quebrachine 17alpha-hydroxyyohimban-16alpha-carboxylic acid methyl ester (16alpha,17alpha)-17-hydroxyyohimban-16-carboxylic acid methyl ester Johimbin Quebrachin Yohimbin aphrodine corynine |
|
id |
CHEBI:10093 |
|
in_subset | ||
inchi |
InChI=1S/C21H26N2O3/c1-26-21(25)19-15-10-17-20-14(13-4-2-3-5-16(13)22-20)8-9-23(17)11-12(15)6-7-18(19)24/h2-5,12,15,17-19,22,24H,6-11H2,1H3/t12-,15-,17-,18-,19+/m0/s1 |
|
inchikey |
BLGXFZZNTVWLAY-SCYLSFHTSA-N |
|
label |
yohimbine |
|
mass |
354.44282 |
|
monoisotopicmass |
354.19434 |
|
notation |
CHEBI:10093 |
|
prefLabel |
yohimbine |
|
RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_131787 |
|
smiles |
[H][C@@]12CC[C@H](O)[C@H](C(=O)OC)[C@@]1([H])C[C@]1([H])N(CCc3c1[nH]c1ccccc31)C2 |
|
subClassOf |