Preferred Name |
rac-lactic acid |
|
Synonyms |
rac-2-hydroxypropanoic acid alpha-hydroxypropionic acid Milchsaeure Lactic acid 2-Hydroxypropionic acid (+-)-2-hydroxypropanoic acid 2-Hydroxypropanoic acid alpha-hydroxypropanoic acid E270 |
|
Definitions |
A racemate comprising equimolar amounts of (R)- and (S)-lactic acid. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_28358 |
|
charge |
0 |
|
database_cross_reference |
KEGG:D00111 Reaxys:1209341 Wikipedia:Lactic_acid Beilstein:1209341 PMID:29079364 LIPID_MAPS_instance:LMFA01050002 CAS:50-21-5 PMID:17190852 KEGG:C01432 DrugBank:DB04398 |
|
definition |
A racemate comprising equimolar amounts of (R)- and (S)-lactic acid. |
|
formula |
C3H6O3 |
|
has exact synonym |
rac-2-hydroxypropanoic acid |
|
has part | ||
has related synonym |
alpha-hydroxypropionic acid Milchsaeure Lactic acid 2-Hydroxypropionic acid (+-)-2-hydroxypropanoic acid 2-Hydroxypropanoic acid alpha-hydroxypropanoic acid E270 |
|
has role | ||
has_alternative_id |
CHEBI:24998 CHEBI:6351 |
|
has_obo_namespace |
chebi_ontology |
|
id |
CHEBI:28358 |
|
in_subset | ||
inchi |
InChI=1S/2C3H6O3/c2*1-2(4)3(5)6/h2*2,4H,1H3,(H,5,6)/t2*2-/m10/s1 |
|
inchikey |
KVZLHPXEUGJPAH-QNDGGIRCSA-N |
|
is conjugate acid of | ||
label |
rac-lactic acid |
|
mass |
180.156 |
|
monoisotopicmass |
180.06339 |
|
notation |
CHEBI:28358 |
|
prefLabel |
rac-lactic acid |
|
smiles |
C(=O)([C@@H](O)C)O.C(=O)([C@H](O)C)O |
|
subClassOf |