Preferred Name |
citrulline |
|
Synonyms |
N(5)-(aminocarbonyl)ornithine 2-Amino-5-uredovaleric acid DL-2-amino-5-ureidovaleric acid dl-citrulline N(5)-carbamoyl-DL-ornithine N(5)-(aminocarbonyl)-DL-ornithine Cit Citrullin citrulina 2-amino-5-(carbamoylamino)pentanoic acid N(5)-carbamoylornithine Citrulline citrulline |
|
Definitions |
The parent compound of the citrulline class consisting of ornithine having a carbamoyl group at the N(5)-position. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_18211 |
|
charge |
0 |
|
database_cross_reference |
PMID:21482070 PMID:16082501 PMID:11113071 Reaxys:1725417 PMID:17513438 PMID:11696417 PMID:19144577 PMID:17558653 PMID:18437289 Beilstein:2328251 CAS:627-77-0 PMID:16708633 PMID:18440672 PMID:17693747 PMID:11094453 PMID:17005970 Wikipedia:Citrulline Beilstein:1725417 PMID:1378088 PMID:18989563 PMID:21129371 |
|
definition |
The parent compound of the citrulline class consisting of ornithine having a carbamoyl group at the N(5)-position. |
|
formula |
C6H13N3O3 |
|
has characteristic | ||
has exact synonym |
2-amino-5-(carbamoylamino)pentanoic acid N(5)-carbamoylornithine Citrulline citrulline |
|
has related synonym |
N(5)-(aminocarbonyl)ornithine 2-Amino-5-uredovaleric acid DL-2-amino-5-ureidovaleric acid dl-citrulline N(5)-carbamoyl-DL-ornithine N(5)-(aminocarbonyl)-DL-ornithine Cit Citrullin citrulina |
|
has role | ||
has_alternative_id |
CHEBI:14002 CHEBI:3730 |
|
has_obo_namespace |
chebi_ontology |
|
id |
CHEBI:18211 |
|
in_subset | ||
inchi |
InChI=1S/C6H13N3O3/c7-4(5(10)11)2-1-3-9-6(8)12/h4H,1-3,7H2,(H,10,11)(H3,8,9,12) |
|
inchikey |
RHGKLRLOHDJJDR-UHFFFAOYSA-N |
|
is conjugate acid of | ||
label |
citrulline |
|
mass |
175.18584 |
|
monoisotopicmass |
175.09569 |
|
notation |
CHEBI:18211 |
|
prefLabel |
citrulline |
|
smiles |
NC(CCCNC(N)=O)C(O)=O |
|
subClassOf |