Preferred Name | phenobarbital | |
Synonyms |
|
|
Definitions |
A member of the class of barbiturates, the structure of which is that of barbituric acid substituted at C-5 by ethyl and phenyl groups. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_8069 |
|
database_cross_reference |
Open TG-Gates compound_id=00004 CAS:50-06-6 CHEBI:8069 DrugBank:DB01174 |
|
definition |
A member of the class of barbiturates, the structure of which is that of barbituric acid substituted at C-5 by ethyl and phenyl groups. |
|
formula |
C12H12N2O3 |
|
has role | ||
label |
phenobarbital |
|
prefixIRI |
CHEBI:8069 |
|
prefLabel |
phenobarbital |
|
smiles |
CCC1(C(=O)NC(=O)NC1=O)c1ccccc1 |
|
subClassOf |
Create mapping