Preferred Name |
chlorpromazine |
|
Synonyms |
3-(2-chloro-10H-phenothiazin-10-yl)-N,N-dimethylpropan-1-amine |
|
Definitions |
A substituted phenothiazine in which the ring nitrogen at position 10 is attached to C-3 of an N,N-dimethylpropanamine moiety. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3647 |
|
database_cross_reference |
DrugBank:DB00477 CAS:50-53-3 LINCS:LSM-4017 |
|
definition |
A substituted phenothiazine in which the ring nitrogen at position 10 is attached to C-3 of an N,N-dimethylpropanamine moiety. |
|
formula |
C17H19ClN2S |
|
has_exact_synonym |
3-(2-chloro-10H-phenothiazin-10-yl)-N,N-dimethylpropan-1-amine |
|
label |
chlorpromazine |
|
prefixIRI |
CHEBI:3647 |
|
prefLabel |
chlorpromazine |
|
smiles |
CN(C)CCCN1c2ccccc2Sc2ccc(Cl)cc12 |
|
subClassOf |
Create mapping