loading...| Preferred Name | 2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexanol | |
| Synonyms |
2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexanol |
|
| Definitions |
A tertiary alcohol that is cyclohexanol substituted at positions 1 and 2 by 3-methoxyphenyl and dimethylaminomethyl groups respectively. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_75722 |
|
| alternative term |
2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexanol |
|
| charge |
0 |
|
| database_cross_reference |
CAS:2914-77-4 |
|
| formula |
C16H25NO2 |
|
| has functional parent | ||
| has_exact_synonym |
2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexanol |
|
| has_obo_namespace |
chebi_ontology |
|
| id |
CHEBI:75722 |
|
| in_subset | ||
| inchi |
InChI=1S/C16H25NO2/c1-17(2)12-14-7-4-5-10-16(14,18)13-8-6-9-15(11-13)19-3/h6,8-9,11,14,18H,4-5,7,10,12H2,1-3H3 |
|
| inchikey |
TVYLLZQTGLZFBW-UHFFFAOYSA-N |
|
| label |
2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexanol |
|
| mass |
263.37520 |
|
| monoisotopicmass |
263.18853 |
|
| notation |
CHEBI:75722 |
|
| prefLabel |
2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexanol |
|
| smiles |
COc1cccc(c1)C1(O)CCCCC1CN(C)C |
|
| textual definition |
A tertiary alcohol that is cyclohexanol substituted at positions 1 and 2 by 3-methoxyphenyl and dimethylaminomethyl groups respectively. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35618 |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.obolibrary.org/obo/CHEBI_75722 | DRON | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_75722 | BERO | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_75722 | DDSS | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_75722 | CHEBI | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_75722 | ECTO | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_75722 | DRON | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_75722 | DRON | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_75722 | BERO | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_75722 | DDSS | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_75722 | CHEBI | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_75722 | ECTO | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_75722 | DRON | LOOM |