Preferred Name |
Pravastatin |
|
Synonyms |
(3R,5R)-3,5-dihydroxy-7-[(1S,2S,6S,8S,8aR)-6-hydroxy-2-methyl-8-{[(2S)-2-methylbutanoyl]oxy}-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]heptanoic acid pravastatine pravastatinum pravastatina pravastatin acid (+)-(3R,5R)-3,5-dihydroxy-7-[(1S,2S,6S,8S,8aR)-6-hydroxy-2-methyl-8-{[(S)-2-methylbutyryl]oxy}-1,2,6,7,8,8a-hexahydro-1-naphthyl]heptanoic acid pravastatin |
|
Definitions |
A carboxylic ester resulting from the formal condensation of (S)-2-methylbutyric acid with the hydroxy group adjacent to the ring junction of (3R,5R)-7-[(1S,2S,6S,8S,8aR)-6,8-dihydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid. Derived from microbial transformation of mevastatin, pravastatin is a reversible inhibitor of 3-hydroxy-3-methylglutaryl-coenzyme A (HMG-CoA). The sodium salt is used for lowering cholesterol and preventing cardiovascular disease. It is one of the lower potency statins, but has the advantage of fewer side effects compared with lovastatin and simvastatin. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_63618 |
|
charge |
0 |
|
database_cross_reference |
Wikipedia:Pravastatin Reaxys:4825538 PMID:25264019 PMID:21749370 HMDB:HMDB0005022 KEGG:C01844 LINCS:LSM-3347 PMID:21851379 DrugBank:DB00175 CAS:81093-37-0 Drug_Central:2239 KEGG:D08410 KNApSAcK:C00000565 |
|
formula |
C23H36O7 |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_35821 http://purl.obolibrary.org/obo/CHEBI_35703 |
|
has_alternative_id |
CHEBI:8360 |
|
has_exact_synonym |
(3R,5R)-3,5-dihydroxy-7-[(1S,2S,6S,8S,8aR)-6-hydroxy-2-methyl-8-{[(2S)-2-methylbutanoyl]oxy}-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]heptanoic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
pravastatine pravastatinum pravastatina pravastatin acid (+)-(3R,5R)-3,5-dihydroxy-7-[(1S,2S,6S,8S,8aR)-6-hydroxy-2-methyl-8-{[(S)-2-methylbutyryl]oxy}-1,2,6,7,8,8a-hexahydro-1-naphthyl]heptanoic acid pravastatin |
|
has_RxCUI |
42463 |
|
id |
CHEBI:63618 |
|
in_subset | ||
inchi |
InChI=1S/C23H36O7/c1-4-13(2)23(29)30-20-11-17(25)9-15-6-5-14(3)19(22(15)20)8-7-16(24)10-18(26)12-21(27)28/h5-6,9,13-14,16-20,22,24-26H,4,7-8,10-12H2,1-3H3,(H,27,28)/t13-,14-,16+,17+,18+,19-,20-,22-/m0/s1 |
|
inchikey |
TUZYXOIXSAXUGO-PZAWKZKUSA-N |
|
is conjugate acid of | ||
label |
pravastatin Pravastatin |
|
mass |
424.52770 |
|
monoisotopicmass |
424.24610 |
|
notation |
CHEBI:63618 |
|
prefixIRI |
CHEBI:63618 |
|
prefLabel |
Pravastatin |
|
smiles |
[H][C@]12[C@H](C[C@H](O)C=C1C=C[C@H](C)[C@@H]2CC[C@@H](O)C[C@@H](O)CC(O)=O)OC(=O)[C@@H](C)CC |
|
textual definition |
A carboxylic ester resulting from the formal condensation of (S)-2-methylbutyric acid with the hydroxy group adjacent to the ring junction of (3R,5R)-7-[(1S,2S,6S,8S,8aR)-6,8-dihydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid. Derived from microbial transformation of mevastatin, pravastatin is a reversible inhibitor of 3-hydroxy-3-methylglutaryl-coenzyme A (HMG-CoA). The sodium salt is used for lowering cholesterol and preventing cardiovascular disease. It is one of the lower potency statins, but has the advantage of fewer side effects compared with lovastatin and simvastatin. |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_36785 http://purl.obolibrary.org/obo/CHEBI_35868 http://purl.obolibrary.org/obo/CHEBI_33308 http://purl.obolibrary.org/obo/CHEBI_35681 |