Preferred Name | Ethambutol | |
Synonyms |
(+)-S,S-ethambutol ethambutolum (S,S)-ethambutol (+)-ethambutol S,S-Ethambutol (2S,7S)-2,7-diethyl-3,6-diazaoctane-1,8-diol (+)-N,N'-bis(1-(hydroxymethyl)propyl)ethylenediamine (+)-2,2'-(ethylenediimino)di-1-butanol EMB etambutol ethambutol (2S,2'S)-2,2'-(ethane-1,2-diyldiimino)dibutan-1-ol Ethambutol |
|
Definitions |
An ethylenediamine derivative that is ethane-1,2-diamine in which one hydrogen attached to each of the nitrogens is sutstituted by a 1-hydroxybutan-2-yl group (S,S-configuration). It is a bacteriostatic antimycobacterial drug, effective against Mycobacterium tuberculosis and some other mycobacteria. It is used (as the dihydrochloride salt) in combination with other antituberculous drugs in the treatment of pulmonary and extrapulmonary tuberculosis; resistant strains of M. tuberculosis are readily produced if ethambutol is used alone. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_4877 |
|
alternative term |
(+)-S,S-ethambutol ethambutolum (S,S)-ethambutol (+)-ethambutol S,S-Ethambutol (2S,7S)-2,7-diethyl-3,6-diazaoctane-1,8-diol (+)-N,N'-bis(1-(hydroxymethyl)propyl)ethylenediamine (+)-2,2'-(ethylenediimino)di-1-butanol EMB etambutol ethambutol (2S,2'S)-2,2'-(ethane-1,2-diyldiimino)dibutan-1-ol Ethambutol |
|
bearer_of |
http://purl.obolibrary.org/obo/CHEBI_35703 |
|
charge |
0 |
|
database_cross_reference |
PMID:14695841 CAS:74-55-5 Reaxys:6312870 Drug_Central:1073 PMID:19648006 PMID:10966749 PMID:19524332 PMID:17210775 Wikipedia:Ethambutol PMID:10649975 PMID:10891117 PMID:17239593 PMID:17276683 PMID:12182855 PMID:16759086 PMID:17851083 PMID:3934384 PMID:17331717 PMID:15225698 PMID:17562368 PMID:16005211 KEGG:C06984 PMID:14698152 PMID:17888665 PMID:16870429 DrugBank:DB00330 Beilstein:6312870 PMID:17315960 KEGG:D07925 |
|
formula |
C10H24N2O2 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_35703 |
|
has_alternative_id |
CHEBI:678172 CHEBI:659237 CHEBI:133410 |
|
has_exact_synonym |
(2S,2'S)-2,2'-(ethane-1,2-diyldiimino)dibutan-1-ol Ethambutol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(+)-S,S-ethambutol ethambutolum (S,S)-ethambutol (+)-ethambutol S,S-Ethambutol (2S,7S)-2,7-diethyl-3,6-diazaoctane-1,8-diol (+)-N,N'-bis(1-(hydroxymethyl)propyl)ethylenediamine (+)-2,2'-(ethylenediimino)di-1-butanol EMB etambutol ethambutol |
|
has_RxCUI |
4110 |
|
id |
CHEBI:4877 |
|
in_subset | ||
inchi |
InChI=1S/C10H24N2O2/c1-3-9(7-13)11-5-6-12-10(4-2)8-14/h9-14H,3-8H2,1-2H3/t9-,10-/m0/s1 |
|
inchikey |
AEUTYOVWOVBAKS-UWVGGRQHSA-N |
|
label |
Ethambutol ethambutol |
|
mass |
204.30980 |
|
monoisotopicmass |
204.18378 |
|
notation |
CHEBI:4877 |
|
prefixIRI |
CHEBI:4877 |
|
prefLabel |
Ethambutol |
|
smiles |
CC[C@@H](CO)NCCN[C@@H](CC)CO |
|
textual definition |
An ethylenediamine derivative that is ethane-1,2-diamine in which one hydrogen attached to each of the nitrogens is sutstituted by a 1-hydroxybutan-2-yl group (S,S-configuration). It is a bacteriostatic antimycobacterial drug, effective against Mycobacterium tuberculosis and some other mycobacteria. It is used (as the dihydrochloride salt) in combination with other antituberculous drugs in the treatment of pulmonary and extrapulmonary tuberculosis; resistant strains of M. tuberculosis are readily produced if ethambutol is used alone. |
|
subClassOf |