Preferred Name |
furosemide |
|
Synonyms |
4-chloro-2-{[(furan-2-yl)methyl]amino}-5-sulfamoylbenzoic acid Furosemide 2-Furfurylamino-4-chloro-5-sulfamoylbenzoic acid 4-Chloro-N-(2-furylmethyl)-5-sulfamoylanthranilic acid 4-Chloro-N-furfuryl-5-sulfamoylanthranilic acid 4-Chloro-5-sulfamoyl-N-furfuryl-anthranilic acid Frusemide Lasix (TN) |
|
Definitions |
A chlorobenzoic acid that is 4-chlorobenzoic acid substituted by a (furan-2-ylmethyl)amino and a sulfamoyl group at position 2 and 5 respectively. It is a diuretic used in the treatment of congestive heart failure. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_47426 |
|
charge |
0 |
|
database_cross_reference |
CAS:54-31-9 Drug_Central:1258 LINCS:LSM-5847 DrugBank:DB00695 PMID:18701232 Reaxys:1399731 HMDB:HMDB0001933 Wikipedia:Furosemide PMID:15286542 KEGG:D00331 VSDB:1770 |
|
formula |
C12H11ClN2O5S |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_35703 |
|
has_alternative_id |
CHEBI:47425 CHEBI:5198 |
|
has_exact_synonym |
4-chloro-2-{[(furan-2-yl)methyl]amino}-5-sulfamoylbenzoic acid Furosemide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
2-Furfurylamino-4-chloro-5-sulfamoylbenzoic acid 4-Chloro-N-(2-furylmethyl)-5-sulfamoylanthranilic acid 4-Chloro-N-furfuryl-5-sulfamoylanthranilic acid 4-Chloro-5-sulfamoyl-N-furfuryl-anthranilic acid Frusemide Lasix (TN) |
|
has_RxCUI |
4603 |
|
id |
CHEBI:47426 |
|
in_subset | ||
inchi |
InChI=1S/C12H11ClN2O5S/c13-9-5-10(15-6-7-2-1-3-20-7)8(12(16)17)4-11(9)21(14,18)19/h1-5,15H,6H2,(H,16,17)(H2,14,18,19) |
|
inchikey |
ZZUFCTLCJUWOSV-UHFFFAOYSA-N |
|
is bearer of | ||
label |
Furosemide furosemide |
|
mass |
330.74400 |
|
monoisotopicmass |
330.00772 |
|
notation |
CHEBI:47426 |
|
prefixIRI |
CHEBI:47426 |
|
prefLabel |
furosemide |
|
smiles |
NS(=O)(=O)c1cc(C(O)=O)c(NCc2ccco2)cc1Cl |
|
textual definition |
A chlorobenzoic acid that is 4-chlorobenzoic acid substituted by a (furan-2-ylmethyl)amino and a sulfamoyl group at position 2 and 5 respectively. It is a diuretic used in the treatment of congestive heart failure. |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_24129 |