loading...| Preferred Name | Captopril | |
| Synonyms |
D-3-mercapto-2-methylpropanoyl-L-proline (2S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]pyrrolidine-2-carboxylic acid captoprilum L-Captopril D-2-methyl-3-mercaptopropanoyl-L-proline Acepress Apopril CP Capoten Captolane Captopryl Captoril Cesplon Dilabar Garranil Hypertil Lopirin Tenosbon Tensobon Tensoprel captopril 1-[(2S)-2-methyl-3-sulfanylpropanoyl]-L-proline |
|
| Definitions |
A L-proline derivative in which L-proline is substituted on nitrogen with a (2S)-2-methyl-3-sulfanylpropanoyl group. It is used as an anti-hypertensive ACE inhibitor drug. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3380 |
|
| alternative term |
D-3-mercapto-2-methylpropanoyl-L-proline (2S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]pyrrolidine-2-carboxylic acid captoprilum L-Captopril D-2-methyl-3-mercaptopropanoyl-L-proline Acepress Apopril CP Capoten Captolane Captopryl Captoril Cesplon Dilabar Garranil Hypertil Lopirin Tenosbon Tensobon Tensoprel captopril 1-[(2S)-2-methyl-3-sulfanylpropanoyl]-L-proline |
|
| bearer_of | ||
| charge |
0 |
|
| database_cross_reference |
DrugBank:DB01197 CAS:62571-86-2 PMID:2420897 Beilstein:477887 PMID:23299024 PMID:23137627 PMID:23397376 PMID:23435971 Patent:US4105776 PMID:23429803 Drug_Central:484 PMID:23278692 LINCS:LSM-5648 Patent:US4046889 PMID:23161035 PMID:23410042 Wikipedia:Captopril KEGG:D00251 PMID:23328620 PMID:23422724 |
|
| formula |
C9H15NO3S |
|
| has role | ||
| has_exact_synonym |
1-[(2S)-2-methyl-3-sulfanylpropanoyl]-L-proline |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
D-3-mercapto-2-methylpropanoyl-L-proline (2S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]pyrrolidine-2-carboxylic acid captoprilum L-Captopril D-2-methyl-3-mercaptopropanoyl-L-proline Acepress Apopril CP Capoten Captolane Captopryl Captoril Cesplon Dilabar Garranil Hypertil Lopirin Tenosbon Tensobon Tensoprel captopril |
|
| has_RxCUI |
1998 |
|
| id |
CHEBI:3380 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H15NO3S/c1-6(5-14)8(11)10-4-2-3-7(10)9(12)13/h6-7,14H,2-5H2,1H3,(H,12,13)/t6-,7+/m1/s1 |
|
| inchikey |
FAKRSMQSSFJEIM-RQJHMYQMSA-N |
|
| is bearer of | ||
| label |
captopril Captopril |
|
| mass |
217.28500 |
|
| monoisotopicmass |
217.07726 |
|
| notation |
CHEBI:3380 |
|
| prefixIRI |
CHEBI:3380 |
|
| prefLabel |
Captopril |
|
| smiles |
C[C@H](CS)C(=O)N1CCC[C@H]1C(O)=O |
|
| textual definition |
A L-proline derivative in which L-proline is substituted on nitrogen with a (2S)-2-methyl-3-sulfanylpropanoyl group. It is used as an anti-hypertensive ACE inhibitor drug. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_46766 http://purl.obolibrary.org/obo/CHEBI_84186 |