loading...| Preferred Name |
alpha-linolenate |
|
| Synonyms |
(9Z,12Z,15Z)-octadeca-9,12,15-trienoate cis,cis,cis-9,12,15-octadecatrienoate (9,12,15)-linolenate (9Z,12Z,15Z)-octadecatrienoate all-cis--9,12,15-octadecatrienoate linolenate |
|
| Definitions |
A linolenate that is the conjugate base of alpha-linolenic acid, arising from deprotonation of the carboxylic acid group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_32387 |
|
| charge |
-1 |
|
| database_cross_reference |
Gmelin:377245 |
|
| formula |
C18H29O2 |
|
| has role | ||
| has_exact_synonym |
(9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
cis,cis,cis-9,12,15-octadecatrienoate (9,12,15)-linolenate (9Z,12Z,15Z)-octadecatrienoate all-cis--9,12,15-octadecatrienoate linolenate |
|
| id |
CHEBI:32387 |
|
| in_subset | ||
| inchi |
InChI=1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,19,20)/p-1/b4-3-,7-6-,10-9- |
|
| inchikey |
DTOSIQBPPRVQHS-PDBXOOCHSA-M |
|
| is conjugate base of | ||
| label |
alpha-linolenate |
|
| mass |
277.42166 |
|
| monoisotopicmass |
277.21730 |
|
| notation |
CHEBI:32387 |
|
| prefLabel |
alpha-linolenate |
|
| smiles |
CC\C=C/C\C=C/C\C=C/CCCCCCCC([O-])=O |
|
| textual definition |
A linolenate that is the conjugate base of alpha-linolenic acid, arising from deprotonation of the carboxylic acid group. |
|
| subClassOf |