loading...| Preferred Name |
L-tyrosine |
|
| Synonyms |
L-Tyrosine L-tyrosine (S)-3-(p-Hydroxyphenyl)alanine (S)-Tyrosine 4-hydroxy-L-phenylalanine (S)-alpha-amino-4-hydroxybenzenepropanoic acid (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid (S)-2-Amino-3-(p-hydroxyphenyl)propionic acid (-)-alpha-amino-p-hydroxyhydrocinnamic acid (S)-(-)-Tyrosine L-Tyrosin TYROSINE Tyr Tyrosine Y |
|
| Definitions |
An optically active form of tyrosine having L-configuration. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17895 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:60-18-4 PMID:15171683 ECMDB:ECMDB00158 Reaxys:392441 Drug_Central:2786 Wikipedia:Tyrosine YMDB:YMDB00364 UM-BBD_compID:c0234 MetaCyc:TYR HMDB:HMDB0000158 Beilstein:392441 DrugBank:DB00135 PMID:22360849 KEGG:D00022 KNApSAcK:C00001397 PMID:22402312 PDBeChem:TYR KEGG:C00082 Gmelin:50929 |
|
| formula |
C9H11NO3 |
|
| has functional parent | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_78675 http://purl.obolibrary.org/obo/CHEBI_27027 |
|
| has_alternative_id |
CHEBI:46070 CHEBI:13181 CHEBI:46161 CHEBI:21411 CHEBI:6313 |
|
| has_exact_synonym |
L-Tyrosine L-tyrosine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(S)-3-(p-Hydroxyphenyl)alanine (S)-Tyrosine 4-hydroxy-L-phenylalanine (S)-alpha-amino-4-hydroxybenzenepropanoic acid (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid (S)-2-Amino-3-(p-hydroxyphenyl)propionic acid (-)-alpha-amino-p-hydroxyhydrocinnamic acid (S)-(-)-Tyrosine L-Tyrosin TYROSINE Tyr Tyrosine Y |
|
| id |
CHEBI:17895 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1 |
|
| inchikey |
OUYCCCASQSFEME-QMMMGPOBSA-N |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| is enantiomer of | ||
| is tautomer of | ||
| label |
L-tyrosine |
|
| mass |
181.18858 |
|
| monoisotopicmass |
181.07389 |
|
| notation |
CHEBI:17895 |
|
| prefLabel |
L-tyrosine |
|
| smiles |
N[C@@H](Cc1ccc(O)cc1)C(O)=O |
|
| textual definition |
An optically active form of tyrosine having L-configuration. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_83813 http://purl.obolibrary.org/obo/CHEBI_18186 |