Preferred Name |
(-)-ephedrine |
|
Synonyms |
(1R,2S)-2-(methylamino)-1-phenylpropan-1-ol (-)-Ephedrine l-ephedrine L-erythro-2-(methylamino)-1-phenylpropan-1-ol (1R,2S)-1-phenyl-1-hydroxy-2-methylaminopropane L-Ephedrine L(-)-ephedrine Ephedrine |
|
Definitions |
A phenethylamine alkaloid that is 2-phenylethanamine substituted by a methyl group at the amino nitrogen and a methyl and a hydroxy group at position 2 and 1 respectively. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_15407 |
|
charge |
0 |
|
database_cross_reference |
KEGG:D00124 PMID:13359219 PMID:27662264 Chemspider:4856 CAS:299-42-3 Reaxys:2208730 PMID:27846433 KEGG:C01575 PMID:13809594 KNApSAcK:C00001409 PMID:21465337 PMID:25660335 Wikipedia:Ephedrine Drug_Central:1024 DrugBank:DB01364 Gmelin:261389 VSDB:2959 |
|
formula |
C10H15NO |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_35524 http://purl.obolibrary.org/obo/CHEBI_35703 http://purl.obolibrary.org/obo/CHEBI_77715 http://purl.obolibrary.org/obo/CHEBI_78298 |
|
has_alternative_id |
CHEBI:18483 CHEBI:132176 CHEBI:10776 CHEBI:4801 |
|
has_exact_synonym |
(1R,2S)-2-(methylamino)-1-phenylpropan-1-ol (-)-Ephedrine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
l-ephedrine L-erythro-2-(methylamino)-1-phenylpropan-1-ol (1R,2S)-1-phenyl-1-hydroxy-2-methylaminopropane L-Ephedrine L(-)-ephedrine Ephedrine |
|
has_RxCUI |
3966 |
|
id |
CHEBI:15407 |
|
in_subset | ||
inchi |
InChI=1S/C10H15NO/c1-8(11-2)10(12)9-6-4-3-5-7-9/h3-8,10-12H,1-2H3/t8-,10-/m0/s1 |
|
inchikey |
KWGRBVOPPLSCSI-WPRPVWTQSA-N |
|
is bearer of | ||
is conjugate base of | ||
label |
(-)-ephedrine Ephedrine |
|
mass |
165.23220 |
|
monoisotopicmass |
165.11536 |
|
notation |
CHEBI:15407 |
|
prefixIRI |
CHEBI:15407 |
|
prefLabel |
(-)-ephedrine |
|
smiles |
CN[C@@H](C)[C@H](O)c1ccccc1 |
|
textual definition |
A phenethylamine alkaloid that is 2-phenylethanamine substituted by a methyl group at the amino nitrogen and a methyl and a hydroxy group at position 2 and 1 respectively. |
|
subClassOf |