Preferred Name | Acetone | |
Synonyms |
Pyroacetic ether Dimethylketon dimethylketone methyl ketone 2-Propanone Dimethyl ketone dimethylcetone beta-Ketopropane Aceton Azeton Propanon propanone propan-2-one ACETONE Acetone acetone |
|
Definitions |
A methyl ketone that consists of propane bearing an oxo group at C2. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_15347 |
|
alternative term |
Pyroacetic ether Dimethylketon dimethylketone methyl ketone 2-Propanone Dimethyl ketone dimethylcetone beta-Ketopropane Aceton Azeton Propanon propanone propan-2-one ACETONE Acetone acetone |
|
bearer_of |
http://purl.obolibrary.org/obo/CHEBI_77941 |
|
charge |
0 |
|
database_cross_reference |
HMDB:HMDB0001659 LIPID_MAPS_instance:LMFA12000057 CAS:67-64-1 PDBeChem:ACN Gmelin:1466 PMID:17190852 Beilstein:635680 Reaxys:635680 KEGG:D02311 KEGG:C00207 Wikipedia:Acetone MetaCyc:ACETONE PMID:17347819 UM-BBD_compID:c0556 |
|
formula |
C3H6O |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_77941 |
|
has_alternative_id |
CHEBI:13708 CHEBI:40571 CHEBI:22182 CHEBI:2398 |
|
has_exact_synonym |
propan-2-one ACETONE Acetone acetone |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Pyroacetic ether Dimethylketon dimethylketone methyl ketone 2-Propanone Dimethyl ketone dimethylcetone beta-Ketopropane Aceton Azeton Propanon propanone |
|
has_RxCUI |
178 |
|
id |
CHEBI:15347 |
|
in_subset | ||
inchi |
InChI=1S/C3H6O/c1-3(2)4/h1-2H3 |
|
inchikey |
CSCPPACGZOOCGX-UHFFFAOYSA-N |
|
label |
Acetone acetone |
|
mass |
58.07914 |
|
monoisotopicmass |
58.04186 |
|
notation |
CHEBI:15347 |
|
prefixIRI |
CHEBI:15347 |
|
prefLabel |
Acetone |
|
smiles |
CC(C)=O |
|
textual definition |
A methyl ketone that consists of propane bearing an oxo group at C2. |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_134179 http://purl.obolibrary.org/obo/CHEBI_26292 |