Jump to:
loading...| Preferred Name | purine ribonucleoside | |
| Synonyms |
purine ribonucleosides |
|
| Definitions |
A ribonucleoside that has a purine moiety as the nucleobase (the R group in the illustration). |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_26399 |
|
| charge |
0 |
|
| definition |
A ribonucleoside that has a purine moiety as the nucleobase (the R group in the illustration). |
|
| formula |
C5H9O4R |
|
| has_related_synonym |
purine ribonucleosides |
|
| hasOBONamespace |
chebi_ontology |
|
| id |
CHEBI:26399 |
|
| inSubset | ||
| label |
purine ribonucleoside |
|
| mass |
133.123 |
|
| monoisotopicmass |
133.05008 |
|
| notation |
CHEBI:26399 |
|
| prefLabel |
purine ribonucleoside |
|
| smiles |
*[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
|
| subClassOf |
Create mapping