Link to this page
Ontology of Drug Neuropathy Adverse Events
Last uploaded:
May 16, 2016
Jump to:
| Preferred Name | Metronidazole | |
| Synonyms |
Elyzol Cc1ncc(n1CCO)[N+]([O-])=O Trichex Vagilen Tricowas B Klont metronidazole Klion Vertisal Efloran Nidagel Entizol Arilin Flagyl Novonidazol Vagimid Clont Noritate C6H9N3O3 InChI=1S/C6H9N3O3/c1-5-7-4-6(9(11)12)8(5)2-3-10/h4,10H,2-3H2,1H3 Metrotop Trikozol Metrocream Fossyol Nalox InChIKey=VAOCPAMSLUNLGC-UHFFFAOYSA-N Metrogel Protostat Zadstat Trichopol 1-(beta-Ethylol)-2-methyl-5-nitro-3-azapyrrole Metrolyl Trikacide Metrogel-Vaginal 2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethanol |
|
| Definitions |
Imidazole substituted at C-1, -2 and -5 with 2-hydroxyethyl, nitro and methyl groups respectively. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6909 |
|
| database_cross_reference |
NIST Chemistry WebBook:443-48-1 CiteXplore:19485831 CiteXplore:14702395 ChemIDplus:443-48-1 KEGG DRUG:D00409 DrugBank:DB00916 Beilstein:611683 CiteXplore:22252819 CiteXplore:15739364 Wikipedia:Metronidazole CiteXplore:16901452 CiteXplore:11906111 CiteXplore:22226009 Patent:US2944061 Reaxys:611683 CiteXplore:18397330
|
|
| definition |
Imidazole substituted at C-1, -2 and -5 with 2-hydroxyethyl, nitro and methyl groups respectively.
|
|
| has_alternative_id |
CHEBI:63636
|
|
| has_exact_synonym |
2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethanol
|
|
| has_related_synonym |
Elyzol Cc1ncc(n1CCO)[N+]([O-])=O Trichex Vagilen Tricowas B Klont metronidazole Klion Vertisal Efloran Nidagel Entizol Arilin Flagyl Novonidazol Vagimid Clont Noritate C6H9N3O3 InChI=1S/C6H9N3O3/c1-5-7-4-6(9(11)12)8(5)2-3-10/h4,10H,2-3H2,1H3 Metrotop Trikozol Metrocream Fossyol Nalox InChIKey=VAOCPAMSLUNLGC-UHFFFAOYSA-N Metrogel Protostat Zadstat Trichopol 1-(beta-Ethylol)-2-methyl-5-nitro-3-azapyrrole Metrolyl Trikacide Metrogel-Vaginal
|
|
| has_RxCUI |
6922
|
|
| id |
CHEBI:6909
|
|
| imported from | ||
| label |
metronidazole Metronidazole
|
|
| notation |
CHEBI:6909
|
|
| prefLabel |
Metronidazole
|
|
| subClassOf |
Add comment
| Delete | Subject | Author | Type | Created |
|---|---|---|---|---|
| No notes to display |
Create mapping