loading...| Preferred Name | retinol | |
| Synonyms |
InChI=1S/C20H30O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,11-13,21H,7,10,14-15H2,1-5H3 C20H30O CC(C=CC=C(C)C=CC1=C(C)CCCC1(C)C)=CCO 286.45160 FPIPGXGPPPQFEQ-UHFFFAOYSA-N retinol 3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraen-1-ol |
|
| Definitions |
A retinoid consisting of 3,7-dimethylnona-2,4,6,8-tetraen-1-ol substituted at position 9 by a 2,6,6-trimethylcyclohex-1-en-1-yl group (geometry of the four exocyclic double bonds is not specified). |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_50211 |
|
| database_cross_reference |
MetaCyc:Retinols LINCS:LSM-5317 |
|
| definition |
A retinoid consisting of 3,7-dimethylnona-2,4,6,8-tetraen-1-ol substituted at position 9 by a 2,6,6-trimethylcyclohex-1-en-1-yl group (geometry of the four exocyclic double bonds is not specified). |
|
| has role | ||
| has_alternative_id |
CHEBI:15037 CHEBI:26538 |
|
| has_exact_synonym |
retinol 3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraen-1-ol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
InChI=1S/C20H30O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,11-13,21H,7,10,14-15H2,1-5H3 C20H30O CC(C=CC=C(C)C=CC1=C(C)CCCC1(C)C)=CCO 286.45160 FPIPGXGPPPQFEQ-UHFFFAOYSA-N |
|
| id |
CHEBI:50211 |
|
| imported from | ||
| label |
retinol |
|
| notation |
CHEBI:50211 |
|
| prefLabel |
retinol |
|
| subClassOf |