Jump to:
loading...| Preferred Name | butenedioic acid | |
| Synonyms |
VZCYOOQTPOCHFL-UHFFFAOYSA-N InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8) C4H4O4 116.07216 2-butenedioic acid [H]C(=C([H])C(O)=O)C(O)=O but-2-enedioic acid |
|
| Definitions |
A C4-dicarboxylic acid that has formula C4H4O4. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_22958 |
|
| database_cross_reference |
Beilstein:8132074 |
|
| definition |
A C4-dicarboxylic acid that has formula C4H4O4. |
|
| has_exact_synonym |
but-2-enedioic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
VZCYOOQTPOCHFL-UHFFFAOYSA-N InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8) C4H4O4 116.07216 2-butenedioic acid [H]C(=C([H])C(O)=O)C(O)=O |
|
| id |
CHEBI:22958 |
|
| imported from | ||
| is conjugate acid of | ||
| label |
butenedioic acid |
|
| notation |
CHEBI:22958 |
|
| prefLabel |
butenedioic acid |
|
| subClassOf |
Create mapping