Preferred Name |
carnitine |
|
Synonyms |
|
|
Definitions |
An amino-acid betaine that is butanoate substituted with a hydroxy group at position C-3 and a trimethylammonium group at C-4. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17126 |
|
charge |
0 |
|
definition |
An amino-acid betaine that is butanoate substituted with a hydroxy group at position C-3 and a trimethylammonium group at C-4. |
|
formula |
C7H15NO3 |
|
has characteristic | ||
has role | ||
has_functional_parent | ||
inchi |
InChI=1S/C7H15NO3/c1-8(2,3)5-6(9)4-7(10)11/h6,9H,4-5H2,1-3H3 |
|
inchikey |
PHIQHXFUZVPYII-UHFFFAOYSA-N |
|
is_conjugate_base_of | ||
label |
carnitine |
|
mass |
161.19894 |
|
monoisotopicmass |
161.10519 |
|
prefixIRI |
CHEBI:17126 |
|
prefLabel |
carnitine |
|
smiles |
C[N+](C)(C)CC(O)CC([O-])=O |
|
subClassOf |
Create mapping