loading...| Preferred Name | methamphetamine | |
| Synonyms |
chalk (+)-(S)-N-alpha-dimethylphenethylamine metanfetamina d-1-phenyl-2-methylaminopropane d-phenylisopropylmethylamine d-N-methylamphetamine d-desoxyephedrine dextromethamphetamine d-deoxyephedrine (alphaS)-N,alpha-dimethylbenzeneethanamine metamfetamine methyl-beta-phenylisopropylamine metamfetaminum (S)-N,alpha-dimethylbenzeneethanamine Methamphetamine (2S)-N-methyl-1-phenylpropan-2-amine |
|
| Definitions |
An amphetamine that has formula C10H15N. A member of the class of amphetamines in which the amino group of (S)-amphetamine carries a methyl substituent. Street names: chalk, crank, crystal, fire, glass, go fast, ice, meth, speed |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6809 |
|
| comment |
Street names: chalk, crank, crystal, fire, glass, go fast, ice, meth, speed |
|
| alternative label |
(+)-(S)-N-alpha-dimethylphenethylamine metanfetamina d-1-phenyl-2-methylaminopropane d-phenylisopropylmethylamine d-N-methylamphetamine d-desoxyephedrine dextromethamphetamine d-deoxyephedrine (alphaS)-N,alpha-dimethylbenzeneethanamine metamfetamine methyl-beta-phenylisopropylamine metamfetaminum (S)-N,alpha-dimethylbenzeneethanamine Methamphetamine (2S)-N-methyl-1-phenylpropan-2-amine |
|
| charge |
0 |
|
| createdDate |
March 5, 2010 |
|
| database_cross_reference |
PMID:18279499 PMID:11984857 PMID:25724762 PMID:14645148 PMID:15808793 PMID:26775284 PMID:26568405 Wikipedia:Methamphetamine PMID:11221576 PMID:19732271 PMID:27232669 PMID:11711870 KEGG:C07164 PMID:14769818 PMID:11717374 PMID:18991862 PMID:19269222 PMID:15380623 PMID:26992824 HMDB:HMDB0015517 PMID:11406298 PMID:19576287 PMID:19384581 PMID:18991860 PMID:15542728 PMID:11829406 PMID:11847428 CAS:537-46-2 PMID:18509037 Beilstein:2207147 KEGG:D08187 PMID:24349338 PMID:26683901 PMID:11831503 Reaxys:2207147 DrugBank:DB01577 PMID:26541330 PMID:18521756 PMID:26302754 PMID:15542724 PMID:11896153 Drug_Central:1732 PDBeChem:B40 |
|
| definition |
An amphetamine that has formula C10H15N. A member of the class of amphetamines in which the amino group of (S)-amphetamine carries a methyl substituent. Street names: chalk, crank, crystal, fire, glass, go fast, ice, meth, speed |
|
| formula |
C10H15N |
|
| has characteristic |
http://purl.obolibrary.org/obo/CHEBI_35471 http://purl.obolibrary.org/obo/CHEBI_35703 |
|
| has exact synonym |
Methamphetamine (2S)-N-methyl-1-phenylpropan-2-amine |
|
| has functional parent | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_35471 http://purl.obolibrary.org/obo/CHEBI_35703 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(+)-(S)-N-alpha-dimethylphenethylamine metanfetamina d-1-phenyl-2-methylaminopropane d-phenylisopropylmethylamine d-N-methylamphetamine d-desoxyephedrine dextromethamphetamine d-deoxyephedrine (alphaS)-N,alpha-dimethylbenzeneethanamine metamfetamine methyl-beta-phenylisopropylamine metamfetaminum (S)-N,alpha-dimethylbenzeneethanamine |
|
| hasStreetName |
meth ice crank fire go fast crystal chalk glass speed |
|
| id |
CHEBI:6809 |
|
| in_subset | ||
| inchi |
InChI=1S/C10H15N/c1-9(11-2)8-10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3/t9-/m0/s1 |
|
| inchikey |
MYWUZJCMWCOHBA-VIFPVBQESA-N |
|
| is conjugate base of | ||
| label |
methamphetamine |
|
| mass |
149.23284 |
|
| modifiedDate |
June 30, 2010 |
|
| monoisotopicmass |
149.12045 |
|
| notation |
CHEBI:6809 |
|
| note |
An amphetamine that has formula C10H15N. A member of the class of amphetamines in which the amino group of (S)-amphetamine carries a methyl substituent. Street names: chalk, crank, crystal, fire, glass, go fast, ice, meth, speed |
|
| preferred label |
methamphetamine |
|
| prefLabel |
methamphetamine |
|
| smiles |
CN[C@@H](C)Cc1ccccc1 |
|
| synonym |
chalk |
|
| subClassOf |