Preferred Name |
nitrate |
|
Synonyms |
trioxonitrate(1-) nitrate trioxidonitrate(1-) trioxonitrate(V) [NO3](-) NITRATE ION NO3 nitrate(1-) NO3(-) |
|
Definitions |
A nitrogen oxoanion formed by loss of a proton from nitric acid. Principal species present at pH 7.3. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17632 |
|
charge |
-1 |
|
database_cross_reference |
Gmelin:1574 MetaCyc:NITRATE Wikipedia:Nitrate CAS:14797-55-8 Beilstein:3587575 PDBeChem:NO3 |
|
definition |
A nitrogen oxoanion formed by loss of a proton from nitric acid. Principal species present at pH 7.3. |
|
formula |
NO3 |
|
has exact synonym |
trioxonitrate(1-) nitrate trioxidonitrate(1-) trioxonitrate(V) |
|
has_alternative_id |
CHEBI:44487 CHEBI:71263 CHEBI:14654 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
[NO3](-) NITRATE ION NO3 nitrate(1-) NO3(-) |
|
id |
CHEBI:17632 |
|
in_subset | ||
inchi |
InChI=1S/NO3/c2-1(3)4/q-1 |
|
inchikey |
NHNBFGGVMKEFGY-UHFFFAOYSA-N |
|
is conjugate base of | ||
label |
nitrate |
|
mass |
62.00490 |
|
monoisotopicmass |
61.98837 |
|
notation |
CHEBI:17632 |
|
prefLabel |
nitrate |
|
smiles |
[O-][N+]([O-])=O |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_33458 |
Create mapping