loading...| Preferred Name | cortisone | |
| Synonyms |
pregn-4-en-17alpha,21-diol-3,11,20-trione 17-hydroxy-11-dehydrocorticosterone Kortison Reichstein's substance Fa Cortison 17alpha,21-dihydroxy-4-pregnene-3,11,20-trione 4-pregnene-17alpha,21-diol-3,11,20-trione Wintersteiner's compound F 11-dehydro-17-hydroxycorticosterone Kendall's compound E 17alpha,21-Dihydroxy-4-pregnene-3,11,20-trione Delta(4)-pregnene-17alpha,21-diol-3,11,20-trione cortisone Cortisone 17,21-dihydroxypregn-4-ene-3,11,20-trione |
|
| Definitions |
A C21-steroid that is pregn-4-ene substituted by hydroxy groups at positions 17 and 21 and oxo group at positions 3, 11 and 20. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16962 |
|
| alternative label |
pregn-4-en-17alpha,21-diol-3,11,20-trione 17-hydroxy-11-dehydrocorticosterone Kortison Reichstein's substance Fa Cortison 17alpha,21-dihydroxy-4-pregnene-3,11,20-trione 4-pregnene-17alpha,21-diol-3,11,20-trione Wintersteiner's compound F 11-dehydro-17-hydroxycorticosterone Kendall's compound E 17alpha,21-Dihydroxy-4-pregnene-3,11,20-trione Delta(4)-pregnene-17alpha,21-diol-3,11,20-trione cortisone Cortisone 17,21-dihydroxypregn-4-ene-3,11,20-trione |
|
| charge |
0 |
|
| database_cross_reference |
Reaxys:1356062 PMID:11710540 PMID:24391193 LIPID_MAPS_instance:LMST02030090 PMID:2268561 KEGG:C00762 PMID:8989250 CAS:53-06-5 MetaCyc:CORTISONE HMDB:HMDB0002802 Wikipedia:Cortisone PMID:14874924 Beilstein:1356062 KEGG:D07749 |
|
| definition |
A C21-steroid that is pregn-4-ene substituted by hydroxy groups at positions 17 and 21 and oxo group at positions 3, 11 and 20. |
|
| formula |
C21H28O5 |
|
| has characteristic | ||
| has exact synonym |
cortisone Cortisone 17,21-dihydroxypregn-4-ene-3,11,20-trione |
|
| has parent hydride | ||
| has role | ||
| has_alternative_id |
CHEBI:3896 CHEBI:23397 CHEBI:14026 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
pregn-4-en-17alpha,21-diol-3,11,20-trione 17-hydroxy-11-dehydrocorticosterone Kortison Reichstein's substance Fa Cortison 17alpha,21-dihydroxy-4-pregnene-3,11,20-trione 4-pregnene-17alpha,21-diol-3,11,20-trione Wintersteiner's compound F 11-dehydro-17-hydroxycorticosterone Kendall's compound E 17alpha,21-Dihydroxy-4-pregnene-3,11,20-trione Delta(4)-pregnene-17alpha,21-diol-3,11,20-trione |
|
| id |
CHEBI:16962 |
|
| in_subset | ||
| inchi |
InChI=1S/C21H28O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h9,14-15,18,22,26H,3-8,10-11H2,1-2H3/t14-,15-,18+,19-,20-,21-/m0/s1 |
|
| inchikey |
MFYSYFVPBJMHGN-ZPOLXVRWSA-N |
|
| label |
cortisone |
|
| mass |
360.44402 |
|
| monoisotopicmass |
360.19367 |
|
| notation |
CHEBI:16962 |
|
| note |
A C21-steroid that is pregn-4-ene substituted by hydroxy groups at positions 17 and 21 and oxo group at positions 3, 11 and 20. |
|
| preferred label |
cortisone |
|
| prefLabel |
cortisone |
|
| smiles |
[H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])C(=O)C[C@@]1(C)[C@@]2([H])CC[C@]1(O)C(=O)CO |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_139590 http://purl.obolibrary.org/obo/CHEBI_139592 http://purl.obolibrary.org/obo/CHEBI_36885 http://purl.obolibrary.org/obo/CHEBI_24261 http://purl.obolibrary.org/obo/CHEBI_35344 http://purl.obolibrary.org/obo/CHEBI_47787 http://purl.obolibrary.org/obo/CHEBI_35342 |