loading...| Preferred Name |
ATP |
|
| Synonyms |
adenosine 5'-(tetrahydrogen triphosphate) ATP ADENOSINE-5'-TRIPHOSPHATE Adenosine triphosphate H4atp Adenosine 5'-triphosphate |
|
| Definitions |
An adenosine 5'-phosphate in which the 5'-phosphate is a triphosphate group. It is involved in the transportation of chemical energy during metabolic pathways. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_15422 |
|
| charge |
0 |
|
| database_cross_reference |
Reaxys:73010 HMDB:HMDB0000538 KNApSAcK:C00001491 Drug_Central:91 PDBeChem:ATP DrugBank:DB00171 KEGG:D08646 KEGG:C00002 Patent:US3079379 Beilstein:73010 Gmelin:34857 Wikipedia:Adenosine_triphosphate CAS:56-65-5 |
|
| definition |
An adenosine 5'-phosphate in which the 5'-phosphate is a triphosphate group. It is involved in the transportation of chemical energy during metabolic pathways. |
|
| formula |
C10H16N5O13P3 |
|
| has exact synonym |
adenosine 5'-(tetrahydrogen triphosphate) ATP |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_78675 http://purl.obolibrary.org/obo/CHEBI_27027 |
|
| has_alternative_id |
CHEBI:10841 CHEBI:10789 CHEBI:40938 CHEBI:22249 CHEBI:13236 CHEBI:2359 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
ADENOSINE-5'-TRIPHOSPHATE Adenosine triphosphate H4atp Adenosine 5'-triphosphate |
|
| id |
CHEBI:15422 |
|
| in_subset | ||
| inchi |
InChI=1S/C10H16N5O13P3/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(26-10)1-25-30(21,22)28-31(23,24)27-29(18,19)20/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H,23,24)(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1 |
|
| inchikey |
ZKHQWZAMYRWXGA-KQYNXXCUSA-N |
|
| is conjugate acid of | ||
| label |
ATP |
|
| mass |
507.18100 |
|
| monoisotopicmass |
506.99575 |
|
| notation |
CHEBI:15422 |
|
| prefLabel |
ATP |
|
| smiles |
Nc1ncnc2n(cnc12)[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O |
|
| subClassOf |