Preferred Name |
estradiol |
|
Synonyms |
estra-1,3,5(10)-triene-3,17-diol 272.178 oestradiol 272.38196 [H][C@]12CC[C@]3(C)C(O)CC[C@@]3([H])[C@]1([H])CCc1cc(O)ccc21 VOXZDWNPVJITMN-WKUFJEKOSA-N 0 C18H24O2 InChI=1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17?,18+/m1/s1 |
|
Definitions |
A 3-hydroxy steroid that is estra-1,3,5(10)-triene substituted by hydroxy groups at positions 3 and 17. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_23965 |
|
database_cross_reference |
colombos:ESTRADIOL Wikipedia:Estradiol PMID:10696569 PMID:24084694 |
|
has exact synonym |
estra-1,3,5(10)-triene-3,17-diol |
|
has parent hydride | ||
has role | ||
has_alternative_id |
CHEBI:42364 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
272.178 oestradiol 272.38196 [H][C@]12CC[C@]3(C)C(O)CC[C@@]3([H])[C@]1([H])CCc1cc(O)ccc21 VOXZDWNPVJITMN-WKUFJEKOSA-N 0 C18H24O2 InChI=1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17?,18+/m1/s1 |
|
id |
CHEBI:23965 |
|
in_subset | ||
label |
estradiol |
|
notation |
CHEBI:23965 |
|
prefLabel |
estradiol |
|
textual definition |
A 3-hydroxy steroid that is estra-1,3,5(10)-triene substituted by hydroxy groups at positions 3 and 17. |
|
subClassOf |