loading...| Preferred Name |
indole-3-acetate |
|
| Synonyms |
(indol-3-yl)acetate -1 SEOVTRFCIGRIMH-UHFFFAOYSA-M 174.17660 InChI=1S/C10H9NO2/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,11H,5H2,(H,12,13)/p-1 2-(indol-3-yl)ethanoate 174.056 C10H8NO2 [O-]C(=O)Cc1c[nH]c2ccccc12 1H-indol-3-ylacetate |
|
| Definitions |
An indol-3-yl carboxylic acid anion that is the conjugate base of indole-3-acetic acid. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_30854 |
|
| database_cross_reference |
Beilstein:3906817 Gmelin:329972 Reaxys:3906817 |
|
| has exact synonym |
1H-indol-3-ylacetate |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_76924 |
|
| has_alternative_id |
CHEBI:14447 CHEBI:14452 CHEBI:24801 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(indol-3-yl)acetate -1 SEOVTRFCIGRIMH-UHFFFAOYSA-M 174.17660 InChI=1S/C10H9NO2/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,11H,5H2,(H,12,13)/p-1 2-(indol-3-yl)ethanoate 174.056 C10H8NO2 [O-]C(=O)Cc1c[nH]c2ccccc12 |
|
| id |
CHEBI:30854 |
|
| in_subset | ||
| is conjugate base of | ||
| label |
indole-3-acetate |
|
| notation |
CHEBI:30854 |
|
| prefLabel |
indole-3-acetate |
|
| textual definition |
An indol-3-yl carboxylic acid anion that is the conjugate base of indole-3-acetic acid. |
|
| subClassOf |