Preferred Name |
butyric acid |
|
Synonyms |
butoic acid FERIUCNNQQJTOY-UHFFFAOYSA-N 88.10510 CCCC(O)=O InChI=1S/C4H8O2/c1-2-3-4(5)6/h2-3H2,1H3,(H,5,6) CH3-[CH2]2-COOH C4:0 n-butanoic acid acide butyrique Butanoate 88.052 acide butanoique n-butyric acid 4:0 1-butanoic acid BUTANOIC ACID propanecarboxylic acid butanoic acid ethylacetic acid C4H8O2 Butanoic acid butanic acid 1-butyric acid Buttersaeure propylformic acid 0 1-propanecarboxylic acid butyric acid Butyric acid |
|
Definitions |
A straight-chain saturated fatty acid that is butane in which one of the terminal methyl groups has been oxidised to a carboxy group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_30772 |
|
database_cross_reference |
HMDB:HMDB00039 PMID:13678314 Beilstein:906770 CAS:107-92-6 PMID:11238216 PMID:14962641 KEGG:C00246 PMID:1542095 PMID:22339023 PMID:22322557 PMID:15938880 PMID:11208715 Gmelin:26242 DrugBank:DB03568 PMID:12068484 PMID:10956204 PMID:10736622 PMID:19366864 Wikipedia:Butyric_acid PMID:11201044 PMID:19703412 PMID:19318247 PMID:22194341 PMID:15809727 PMID:21699495 PDBeChem:BUA MetaCyc:BUTYRIC_ACID PMID:11305323 Reaxys:906770 PMID:22038864 LIPID_MAPS_instance:LMFA01010004 PMID:15810631 KNApSAcK:C00001180 PMID:22466881 |
|
has exact synonym |
butyric acid butanoic acid Butyric acid |
|
has role | ||
has_alternative_id |
CHEBI:22948 CHEBI:113450 CHEBI:3234 CHEBI:41208 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
butoic acid FERIUCNNQQJTOY-UHFFFAOYSA-N 88.10510 CCCC(O)=O InChI=1S/C4H8O2/c1-2-3-4(5)6/h2-3H2,1H3,(H,5,6) CH3-[CH2]2-COOH C4:0 n-butanoic acid acide butyrique Butanoate 88.052 acide butanoique n-butyric acid 4:0 1-butanoic acid BUTANOIC ACID propanecarboxylic acid butanoic acid ethylacetic acid C4H8O2 Butanoic acid butanic acid 1-butyric acid Buttersaeure propylformic acid 0 1-propanecarboxylic acid |
|
id |
CHEBI:30772 |
|
in_subset | ||
is conjugate acid of | ||
label |
butyric acid |
|
notation |
CHEBI:30772 |
|
prefLabel |
butyric acid |
|
textual definition |
A straight-chain saturated fatty acid that is butane in which one of the terminal methyl groups has been oxidised to a carboxy group. |
|
subClassOf |