Preferred Name |
aspartic acid |
|
Synonyms |
aspartic acid Aspartic acid InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9) DL-Asparagic acid (+-)-Aspartic acid 133.038 C4H7NO4 2-aminobutanedioic acid (R,S)-Aspartic acid NC(CC(O)=O)C(O)=O DL-Aminosuccinic acid Asp CKLJMWTZIZZHCS-UHFFFAOYSA-N D 133.10272 0 |
|
Definitions |
An alpha-amino acid that consists of succinic acid bearing a single alpha-amino substituent |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_22660 |
|
database_cross_reference |
Reaxys:774618 KEGG:C16433 Gmelin:185140 PMID:22264337 Beilstein:774618 Wikipedia:Aspartic_acid CAS:617-45-8 |
|
has exact synonym |
aspartic acid Aspartic acid |
|
has part | ||
has role | ||
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9) DL-Asparagic acid (+-)-Aspartic acid 133.038 C4H7NO4 2-aminobutanedioic acid (R,S)-Aspartic acid NC(CC(O)=O)C(O)=O DL-Aminosuccinic acid Asp CKLJMWTZIZZHCS-UHFFFAOYSA-N D 133.10272 0 |
|
id |
CHEBI:22660 |
|
in_subset | ||
is conjugate acid of | ||
label |
aspartic acid |
|
notation |
CHEBI:22660 |
|
prefLabel |
aspartic acid |
|
textual definition |
An alpha-amino acid that consists of succinic acid bearing a single alpha-amino substituent |
|
subClassOf |