Preferred Name | maleic acid | |
Synonyms |
(Z)-2-butenedioic acid cis-Butenedioic acid C4H4O4 116.07216 cis-1,2-ethylenedicarboxylic acid toxilic acid H2male InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1- VZCYOOQTPOCHFL-UPHRSURJSA-N cis-but-2-enedioic acid OC(=O)\C=C/C(O)=O (Z)-butenedioic acid 116.011 0 Maleic acid MALEIC ACID (2Z)-but-2-enedioic acid |
|
Definitions |
A butenedioic acid in which the double bond has cis- (Z)-configuration. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_18300 |
|
database_cross_reference |
Wikipedia:Maleic_acid PMID:22770225 PMID:10952545 PMID:11386868 DrugBank:DB04299 Beilstein:1903639 MetaCyc:MALEATE Reaxys:605762 KEGG:C01384 PMID:9591280 Gmelin:49854 Beilstein:605762 CAS:110-16-7 HMDB:HMDB00176 PDBeChem:MAE KNApSAcK:C00007417 |
|
has exact synonym |
Maleic acid MALEIC ACID (2Z)-but-2-enedioic acid |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_76924 |
|
has_alternative_id |
CHEBI:43836 CHEBI:25119 CHEBI:6653 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(Z)-2-butenedioic acid cis-Butenedioic acid C4H4O4 116.07216 cis-1,2-ethylenedicarboxylic acid toxilic acid H2male InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1- VZCYOOQTPOCHFL-UPHRSURJSA-N cis-but-2-enedioic acid OC(=O)\C=C/C(O)=O (Z)-butenedioic acid 116.011 0 |
|
id |
CHEBI:18300 |
|
in_subset | ||
is conjugate acid of | ||
label |
maleic acid |
|
notation |
CHEBI:18300 |
|
prefLabel |
maleic acid |
|
textual definition |
A butenedioic acid in which the double bond has cis- (Z)-configuration. |
|
subClassOf |