Preferred Name |
L-cysteine |
|
Synonyms |
L-cysteine L-Cysteine C E-920 121.020 N[C@@H](CS)C(O)=O (2R)-2-amino-3-mercaptopropanoic acid L-2-Amino-3-mercaptopropionic acid C3H7NO2S L-Zystein Cys E 920 (R)-2-amino-3-mercaptopropanoic acid L-Cystein InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m0/s1 0 CYSTEINE XUJNEKJLAYXESH-REOHCLBHSA-N FREE CYSTEINE E920 (2R)-2-amino-3-sulfanylpropanoic acid 121.15800 |
|
Definitions |
An optically active form of cysteine having L-configuration. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17561 |
|
database_cross_reference |
Wikipedia:Cysteine HMDB:HMDB00574 ECMDB:ECMDB00574 KNApSAcK:C00001351 PMID:13761469 CAS:52-90-4 Gmelin:49991 PDBeChem:CYS MetaCyc:CYS DrugBank:DB00151 Reaxys:1721408 PMID:11732994 PMID:22735334 KEGG:D00026 YMDB:YMDB00046 KEGG:C00097 Beilstein:1721408 Drug_Central:769 |
|
has exact synonym |
L-cysteine L-Cysteine |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_77703 |
|
has_alternative_id |
CHEBI:41700 CHEBI:41227 CHEBI:41781 CHEBI:41768 CHEBI:41811 CHEBI:6207 CHEBI:21261 CHEBI:13095 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
C E-920 121.020 N[C@@H](CS)C(O)=O (2R)-2-amino-3-mercaptopropanoic acid L-2-Amino-3-mercaptopropionic acid C3H7NO2S L-Zystein Cys E 920 (R)-2-amino-3-mercaptopropanoic acid L-Cystein InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m0/s1 0 CYSTEINE XUJNEKJLAYXESH-REOHCLBHSA-N FREE CYSTEINE E920 (2R)-2-amino-3-sulfanylpropanoic acid 121.15800 |
|
id |
CHEBI:17561 |
|
in_subset | ||
is conjugate acid of | ||
is conjugate base of | ||
is enantiomer of | ||
is tautomer of | ||
label |
L-cysteine |
|
notation |
CHEBI:17561 |
|
prefLabel |
L-cysteine |
|
textual definition |
An optically active form of cysteine having L-configuration. |
|
subClassOf |