loading...| Preferred Name | carnitine | |
| Synonyms |
PHIQHXFUZVPYII-UHFFFAOYSA-N C[N+](C)(C)CC(O)CC([O-])=O D,L-carnitine InChI=1S/C7H15NO3/c1-8(2,3)5-6(9)4-7(10)11/h6,9H,4-5H2,1-3H3 C7H15NO3 161.19894 161.105 0 carnitine 3-hydroxy-4-(trimethylammonio)butanoate |
|
| Definitions |
An amino-acid betaine that is butanoate substituted with a hydroxy group at position C-3 and a trimethylammonium group at C-4. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17126 |
|
| database_cross_reference |
PMID:23868375 PMID:22770225 CAS:461-06-3 KEGG:C00487 Wikipedia:Carnitine Patent:US4255449 DrugBank:DB02648 Reaxys:1866665 Beilstein:1866665 MetaCyc:DL-CARNITINE Patent:US4315944 |
|
| has exact synonym |
carnitine 3-hydroxy-4-(trimethylammonio)butanoate |
|
| has functional parent | ||
| has role | ||
| has_alternative_id |
CHEBI:23038 CHEBI:20047 CHEBI:13947 CHEBI:11817 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
PHIQHXFUZVPYII-UHFFFAOYSA-N C[N+](C)(C)CC(O)CC([O-])=O D,L-carnitine InChI=1S/C7H15NO3/c1-8(2,3)5-6(9)4-7(10)11/h6,9H,4-5H2,1-3H3 C7H15NO3 161.19894 161.105 0 |
|
| id |
CHEBI:17126 |
|
| in_subset | ||
| is conjugate base of | ||
| label |
carnitine |
|
| notation |
CHEBI:17126 |
|
| prefLabel |
carnitine |
|
| textual definition |
An amino-acid betaine that is butanoate substituted with a hydroxy group at position C-3 and a trimethylammonium group at C-4. |
|
| subClassOf |