loading...| Preferred Name | methionine | |
| Synonyms |
Methionin 2-amino-4-(methylsulfanyl)butanoic acid 2-Amino-4-(methylthio)butyric acid Hmet 2-amino-4-(methylthio)butanoic acid FFEARJCKVFRZRR-UHFFFAOYSA-N Met InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8) 149.21238 Racemethionine DL-Methionine alpha-amino-gamma-methylmercaptobutyric acid metionina C5H11NO2S 149.051 CSCCC(N)C(O)=O 0 M methionine Methionine |
|
| Definitions |
A sulfur-containing amino acid that is butyric acid bearing an amino substituent at position 2 and a methylthio substituent at position 4. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16811 |
|
| database_cross_reference |
colombos:METHIONINE KEGG:D04983 Wikipedia:Methionine CAS:59-51-8 UM-BBD_compID:c0094 PMID:22264337 Beilstein:636185 Reaxys:636185 PMID:2543976 PMID:16702333 KEGG:C01733 Gmelin:3117 |
|
| has exact synonym |
methionine Methionine |
|
| has functional parent | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_83056 http://purl.obolibrary.org/obo/CHEBI_75772 |
|
| has_alternative_id |
CHEBI:14590 CHEBI:25229 CHEBI:6829 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Methionin 2-amino-4-(methylsulfanyl)butanoic acid 2-Amino-4-(methylthio)butyric acid Hmet 2-amino-4-(methylthio)butanoic acid FFEARJCKVFRZRR-UHFFFAOYSA-N Met InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8) 149.21238 Racemethionine DL-Methionine alpha-amino-gamma-methylmercaptobutyric acid metionina C5H11NO2S 149.051 CSCCC(N)C(O)=O 0 M |
|
| id |
CHEBI:16811 |
|
| in_subset | ||
| is conjugate acid of | ||
| is conjugate base of | ||
| is tautomer of | ||
| label |
methionine |
|
| notation |
CHEBI:16811 |
|
| prefLabel |
methionine |
|
| textual definition |
A sulfur-containing amino acid that is butyric acid bearing an amino substituent at position 2 and a methylthio substituent at position 4. |
|
| subClassOf |