loading...| Preferred Name |
pimozide |
|
| Synonyms |
Halomonth Neoperidole pimozida pimozide pimozidum Orap Opiran 1-{1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl}-1,3-dihydro-2H-benzimidazol-2-one Pimozide |
|
| Definitions |
A member of the class of benzimidazoles that is 1,3-dihydro-2H-benzimidazol-2-one in which one of the nitrogens is substituted by a piperidin-4-yl group, which in turn is substituted on the nitrogen by a 4,4-bis(p-fluorophenyl)butyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8212 |
|
| bearer_of | ||
| charge |
0 |
|
| database_cross_reference |
NCIt:C47672 MeSH:D010868 SNOMEDCT:386848009 SNOMEDCT:108438008 Beilstein:729089 KEGG:C07566 Wikipedia:Pimozide CAS:2062-78-4 KEGG:D00560 Drug_Central:2172 Reaxys:729089 DrugBank:DB01100 HMDB:HMDB0015232 LINCS:LSM-2001 |
|
| definition |
A member of the class of benzimidazoles that is 1,3-dihydro-2H-benzimidazol-2-one in which one of the nitrogens is substituted by a piperidin-4-yl group, which in turn is substituted on the nitrogen by a 4,4-bis(p-fluorophenyl)butyl group. |
|
| formula |
C28H29F2N3O |
|
| has_exact_synonym |
1-{1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl}-1,3-dihydro-2H-benzimidazol-2-one pimozide Pimozide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Halomonth Neoperidole pimozida pimozide pimozidum Orap Opiran |
|
| has_role | ||
| id |
CHEBI:8212 |
|
| in_subset | ||
| inchi |
InChI=1S/C28H29F2N3O/c29-22-11-7-20(8-12-22)25(21-9-13-23(30)14-10-21)4-3-17-32-18-15-24(16-19-32)33-27-6-2-1-5-26(27)31-28(33)34/h1-2,5-14,24-25H,3-4,15-19H2,(H,31,34) |
|
| inchikey |
YVUQSNJEYSNKRX-UHFFFAOYSA-N |
|
| label |
pimozide |
|
| mass |
461.54620 |
|
| monoisotopicmass |
461.22787 |
|
| notation |
CHEBI:8212 |
|
| preferred label |
pimozide |
|
| prefLabel |
pimozide |
|
| smiles |
Fc1ccc(cc1)C(CCCN1CCC(CC1)n1c2ccccc2[nH]c1=O)c1ccc(F)cc1 |
|
| subClassOf |