Preferred Name | metformin | |
Synonyms |
|
|
Definitions |
A member of the class of guanidines that is biguanide the carrying two methyl substituents at position 1. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_6801 |
|
definition |
A member of the class of guanidines that is biguanide the carrying two methyl substituents at position 1. |
|
formula |
CN(C)C(=N)NC(N)=N |
|
has role | ||
InChI |
InChI=1S/C4H11N5/c1-9(2)4(7)8-3(5)6/h1-2H3,(H5,5,6,7,8) |
|
InChIKey |
XZWYZXLIPXDOLR-UHFFFAOYSA-N |
|
label |
metformin |
|
prefixIRI |
CHEBI:6801 |
|
prefLabel |
metformin |
|
subClassOf |
Create mapping