loading...| Preferred Name | dexamethasone | |
| Synonyms |
9alpha-Fluoro-16alpha-methylprednisolone dexamethasonum Decadron 1-Dehydro-16alpha-methyl-9alpha-fluorohydrocortisone dexametasona dexamethasone 16alpha-Methyl-9alpha-fluoro-1-dehydrocortisol 9-fluoro-11beta,17,21-trihydroxy-16alpha-methylpregna-1,4-diene-3,20-dione Dexamethasone |
|
| Definitions |
A fluorinated steroid that is 9-fluoropregna-1,4-diene substituted by hydroxy groups at positions 11, 17 and 21, a methyl group at position 16 and oxo groups at positions 3 and 20. It is a synthetic member of the class of glucocorticoids. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_41879 |
|
| charge |
0 |
|
| database cross reference |
Patent:GB869511 VSDB:1769 PMID:18272184 DrugBank:DB01234 PMID:18524938 Patent:US3007923 CAS:50-02-2 Reaxys:2066652 PMID:32412710 HMDB:HMDB0015364 Beilstein:2066652 Wikipedia:Dexamethasone Drug_Central:824 PMID:11508649 Patent:DE1113690 |
|
| definition |
A fluorinated steroid that is 9-fluoropregna-1,4-diene substituted by hydroxy groups at positions 11, 17 and 21, a methyl group at position 16 and oxo groups at positions 3 and 20. It is a synthetic member of the class of glucocorticoids. |
|
| formula |
C22H29FO5 |
|
| has role | ||
| has_exact_synonym |
9-fluoro-11beta,17,21-trihydroxy-16alpha-methylpregna-1,4-diene-3,20-dione Dexamethasone dexamethasone |
|
| has_related_synonym |
9alpha-Fluoro-16alpha-methylprednisolone dexamethasonum Decadron 1-Dehydro-16alpha-methyl-9alpha-fluorohydrocortisone dexametasona dexamethasone 16alpha-Methyl-9alpha-fluoro-1-dehydrocortisol |
|
| InChI |
InChI=1S/C22H29FO5/c1-12-8-16-15-5-4-13-9-14(25)6-7-19(13,2)21(15,23)17(26)10-20(16,3)22(12,28)18(27)11-24/h6-7,9,12,15-17,24,26,28H,4-5,8,10-11H2,1-3H3/t12-,15+,16+,17+,19+,20+,21+,22+/m1/s1 |
|
| InChIKey |
UREBDLICKHMUKA-CXSFZGCWSA-N |
|
| label |
dexamethasone |
|
| mass |
392.46106 |
|
| Monoisotopic Mass |
392.19990 |
|
| notation |
HOIP_0040473 |
|
| prefixIRI |
CHEBI:41879 |
|
| prefLabel |
dexamethasone |
|
| smiles |
[H][C@@]12C[C@@H](C)[C@](O)(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])CCC2=CC(=O)C=C[C@]12C |
|
| subClassOf |