Link to this page
Human Interaction Network Ontology
Last uploaded:
June 27, 2014
Jump to:
| Preferred Name | butyric acid | |
| Synonyms |
butoic acid CCCC(O)=O InChI=1S/C4H8O2/c1-2-3-4(5)6/h2-3H2,1H3,(H,5,6) CH3-[CH2]2-COOH C4:0 n-butanoic acid acide butyrique acide butanoique InChIKey=FERIUCNNQQJTOY-UHFFFAOYSA-N n-butyric acid 4:0 1-butanoic acid BUTANOIC ACID propanecarboxylic acid butanoic acid ethylacetic acid C4H8O2 Butanoic acid butanic acid 1-butyric acid Buttersaeure propylformic acid 1-propanecarboxylic acid butyric acid Butyric acid |
|
| Definitions |
A four-carbon straight-chain saturated fatty acid. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_30772 |
|
| database_cross_reference |
CiteXplore:22322557 HMDB:HMDB00039 KEGG COMPOUND:C00246 Beilstein:906770 CiteXplore:22038864 CiteXplore:15938880 CiteXplore:11238216 CiteXplore:13678314 CiteXplore:11305323 CiteXplore:21699495 CiteXplore:19366864 ChEMBL:1542095 CiteXplore:19318247 CiteXplore:11201044 ChEMBL:10956204 Gmelin:26242 CiteXplore:22194341 DrugBank:DB03568 CiteXplore:11208715 CiteXplore:15810631 CiteXplore:10736622 Wikipedia:Butyric_acid CiteXplore:14962641 CiteXplore:15809727 LIPID MAPS:LMFA01010004 KEGG COMPOUND:107-92-6 CiteXplore:19703412 CiteXplore:22339023 PDBeChem:BUA ChemIDplus:107-92-6 MetaCyc:BUTYRIC_ACID Reaxys:906770 CiteXplore:12068484 NIST Chemistry WebBook:107-92-6 CiteXplore:22466881
|
|
| definition |
A four-carbon straight-chain saturated fatty acid.
|
|
| has_alternative_id |
CHEBI:22948 CHEBI:113450 CHEBI:3234 CHEBI:41208
|
|
| has_exact_synonym |
butyric acid butanoic acid Butyric acid
|
|
| has_obo_namespace |
chebi_ontology
|
|
| has_related_synonym |
butoic acid CCCC(O)=O InChI=1S/C4H8O2/c1-2-3-4(5)6/h2-3H2,1H3,(H,5,6) CH3-[CH2]2-COOH C4:0 n-butanoic acid acide butyrique acide butanoique InChIKey=FERIUCNNQQJTOY-UHFFFAOYSA-N n-butyric acid 4:0 1-butanoic acid BUTANOIC ACID propanecarboxylic acid butanoic acid ethylacetic acid C4H8O2 Butanoic acid butanic acid 1-butyric acid Buttersaeure propylformic acid 1-propanecarboxylic acid
|
|
| id |
CHEBI:30772
|
|
| imported from | ||
| label |
butyric acid
|
|
| notation |
CHEBI:30772
|
|
| prefixIRI |
CHEBI:30772
|
|
| prefLabel |
butyric acid
|
|
| subClassOf |
Add comment
| Delete | Subject | Author | Type | Created |
|---|---|---|---|---|
| No notes to display |
Create mapping